Zu "K09568" wurden 80 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AP20187
Artikelnummer: TGM-T14299-5mg
Description: AP20187 (B/B Homodimerizer) is a cell-permeable compound used to dimerize FK506-binding protein (FKBP) fusion proteins, thereby initiating biological signaling cascades, gene expression, or disrupting protein-protein interactions. Target: Others. Smiles:...
| Schlagworte: | B/B Homodimerizer |
| Anwendung: | FKBP fusion protein chemical inducer of dimerization (CID) |
| CAS | 195514-80-8 |
| MW: | 1482.75 D |
ab 87,00 €
FKBP12 Protein, Human, Recombinant (His)
Artikelnummer: TGM-TMPY-00808-100ug
Description: FKBP12 Protein, Human, Recombinant (His) is expressed in E. coli expression system with His tag. The predicted molecular weight is 12.9 kDa and the accession number is P62942.
| Schlagworte: | FKBP-12, PKC12, FKBP12, FKBP1, FKBP-1A, PPIASE, FK506 binding protein 1A, PKCI2 |
| MW: | 12.9 kD |
290,00 €
Tacrolimus-13C-d2
Artikelnummer: TGM-TMIH-0548-1mg
Description: Tacrolimus-13C-d2 is the 13C and deuterated compound of Tacrolimus. Smiles: [2H]\[13C]([2H])=C/C[C@@H]1\C=C(C)\C[C@H](C)C[C@H](OC)[C@H]2O[C@](O)([C@H](C)C[C@@H]2OC)C(=O)C(=O)N2CCCC[C@H]2C(=O)O[C@@H]([C@H](C)[C@@H](O)CC1=O)C(\C)=C\[C@@H]1CC[C@@H](O)[C@@H](C1)OC
| Anwendung: | GC-MS, LC-MS, internal standard, immunosuppressant |
| CAS | 1356841-89-8 |
| MW: | 807.02 D |
809,00 €
FKBP12 Protein, Mouse, Recombinant (His)
Artikelnummer: TGM-TMPY-01662-100ug
Description: FKBP12 Protein, Mouse, Recombinant (His) is expressed in E. coli expression system with His tag. The predicted molecular weight is 12.7 kDa and the accession number is P26883.
| Schlagworte: | FKBP12, Fkbp, FK506 binding protein 1A, Fkbp1 |
| MW: | 12.7 kD |
389,00 €
Shield-1
Artikelnummer: TGM-T13884-100mg
Description: Shield-1 is a specific, high-affinity and cell-permeant ligand of FK506-binding protein-12 (FKBP), and reverses the instability by binding to mutated FKBP (mtFKBP), allowing conditional expression of mtFKBP-fused proteins. Shield-1 can stabilize the entire fusion protein. Target: Others. Smiles:...
| Anwendung: | Protein stabilizing ligand |
| CAS | 914805-33-7 |
| MW: | 748.9 D |
ab 159,00 €
Thalidomide-O-amido-PEG-C2-NH2
Artikelnummer: TGM-T39427-100mg
Description: Thalidomide-O-amido-PEG-C2-NH2 is a synthesized conjugate formulation designed as an E3 ligase ligand-linker conjugate, incorporating a cereblon ligand based on Thalidomide and a linker component commonly used in PROTAC technology. Target: Others. Smiles:...
| Schlagworte: | Thalidomide-O-amido-PEG-C2-NH2 |
| Anwendung: | Protac(R) reagent |
| CAS | 2022182-59-6 |
| MW: | 418.4 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Anti-FKBP1A
Artikelnummer: CSB-PA02325A0Rb.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: FKBP1A. Antigen Species: Human
| Schlagworte: | Anti-FKBP1, Anti-FKBP1A, Anti-FKBP-12, Anti-FKBP-1A, Anti-Rotamase, Anti-Calstabin-1, Anti-12 kDa FKBP, Anti-PPIase... |
| Anwendung: | ELISA, WB, IHC, IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 163,00 €
Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A),...
Artikelnummer: CSB-EP008691HU1.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 2-103aa. Protein Length: Partial. Tag Info: N-terminal GST-tagged. Target Protein Sequence: GVQVETISPG DGRTFPKRGQ TCVVHYTGML EDGKKFDSSR DRNKPFKFML GKQEVIRGWE EGVAQMSVGQ RAKLTISPDY AYGATGHPGI IPPHATLVFD VE. Purity: Greater than 90% as determined by...
| Schlagworte: | FKBP1, FKBP1A, FKBP-12, FKBP-1A, Rotamase, Calstabin-1, 12 kDa FKBP, PPIase FKBP1A, Immunophilin FKBP12, FK506-binding... |
| Anwendung: | Activity not tested |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 38.2 kD |
ab 213,00 €
FK-506
Artikelnummer: Cay10007965-5
FK-506 is a potent immunosuppressant in the same molecular class as cyclosporin A (Cay-12088) and rapamycin (Cay-13346). Its mechanism of action involves the formation of a high affinity complex (Ki = 0.2 nM) with FK-506 binding protein 12 (FKBP12). This complex then inhibits the activity of the...
| Schlagworte: | Tacrolimus,... |
| Anwendung: | Immunosuppressant |
| CAS | 104987-11-3 |
| MW: | 804 D |
ab 48,00 €
Anti-FKBP12 / FKBP1A
Artikelnummer: NSJ-F54946-0.08ML
In 1X PBS, pH 7.4, with 0.09% sodium azide. FKBP12 is a member of the immunophilin protein family, which play a role in immunoregulation and basic cellular processes involving protein folding and trafficking. The protein is a cis-trans prolyl isomerase that binds the immunosuppressants FK506 and rapamycin. It...
| Schlagworte: | Anti-FKBP1, Anti-FKBP1A, Anti-FKBP-1A, Anti-FKBP-12, Anti-Rotamase, Anti-Calstabin-1, Anti-12 kDa FKBP, Anti-PPIase... |
| Anwendung: | FC, WB, IHC (paraffin) |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 326,00 €
Anti-FKBP1B
Artikelnummer: NSJ-F54955-0.08ML
In 1X PBS, pH 7.4, with 0.09% sodium azide. FKBP1B is a member of the immunophilin protein family, which play a role in immunoregulation and basic cellular processes involving protein folding and trafficking. This protein is a cis-trans prolyl isomerase that binds the immunosuppressants FK506 and rapamycin. The...
| Schlagworte: | Anti-FKBP-1B, Anti-FKBP12.6, Anti-Rotamase, Anti-FKBP-12.6, Anti-h-FKBP-12, Anti-PPIase FKBP1B, Anti-12.6 kDa FKBP,... |
| Anwendung: | IF, IHC (paraffin), WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 326,00 €
Anti-FKBP1A/B
Artikelnummer: NSJ-RQ7173
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Peptidyl-prolyl cis-trans isomerase FKBP1A/1B is an enzyme that in humans is encoded by the FKBP1A/1B gene. The protein encoded by this gene is a member of the immunophilin protein family, which play a role in immunoregulation and basic cellular processes...
| Schlagworte: | Anti-FKBP1, Anti-FKBP1A, Anti-FKBP-1A, Anti-FKBP-12, Anti-Rotamase, Anti-Calstabin-1, Anti-12 kDa FKBP, Anti-PPIase... |
| Anwendung: | WB, IHC (paraffin), FC, Direct ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
755,00 €