Zu "K08800" wurden 41 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ON123300
Artikelnummer: TGM-T6920-100mg
Description: ON123300 is a potent and multi-targeted kinase inhibitor for CDK4/Ark5/PDGFRbeta/FGFR1/RET/Fyn (IC50: 3.9/5/26/26/9.2/11 nM). Target: Src, AMPK, CDK, c-RET, PDGFR, JAK, FGFR. Smiles: CN1CCN(CC1)c1ccc(Nc2ncc3cc(C#N)c(=O)n(C4CCCC4)c3n2)cc1. References: Divakar SK, et al .Leukemia. 2016 Jan,30(1):86-93.
| Anwendung: | CDK inhibitor |
| CAS | 1357470-29-1 |
| MW: | 429.52 D |
ab 40,00 €
WZ4003
Artikelnummer: TGM-T6291-100mg
Description: WZ4003, a highly selective NUAK kinase inhibitor, is with IC50 of 20 nM and 100 nM for NUAK1 and NUAK2, respectively. It is no significant inhibition on 139 other kinases. Target: AMPK. Smiles: CCC(=O)Nc1cccc(Oc2nc(Nc3ccc(cc3OC)N3CCN(C)CC3)ncc2Cl)c1. References: Banerjee S, et al. Biochem J. 2014,...
| Anwendung: | Selective NUAK1 / NUAK2 inhibitor |
| CAS | 1214265-58-3 |
| MW: | 496.99 D |
ab 43,00 €
Anti-NUAK1
Artikelnummer: CSB-PA203867.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: NUAK1. Antigen Species: Human
| Schlagworte: | Anti-ARK5, Anti-NUAK1, EC=2.7.11.1, Anti-Omphalocele kinase 1, Anti-AMPK-related protein kinase 5, Anti-NUAK family... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 167,00 €
Anti-NUAK1
Artikelnummer: CSB-PA925362.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: NUAK1. Antigen Species: Human
| Schlagworte: | Anti-ARK5, Anti-NUAK1, EC=2.7.11.1, Anti-Omphalocele kinase 1, Anti-AMPK-related protein kinase 5, Anti-NUAK family... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 167,00 €
HTH-01-015
Artikelnummer: Cay19091-1
NUAK1 (also known as AMPK-related kinase 5) and NUAK2 (also known as SNF1/AMPK-related kinase) are members of the AMP-activated protein kinase (AMPK) family of protein kinases that are activated by the liver kinase B1 tumor suppressor kinase. NUAK kinases are thought to have roles in regulating cell adhesion, cancer...
| Schlagworte: | 5,13-dihydro-4,5,13-trimethyl-2-[[1-(4-piperidinyl)-1H-pyrazol-4-yl]amino]-6H-naphtho[2,3-e]pyrimido[5,4-b][1,4]diazepin-6... |
| Anwendung: | Selective NUAK1 inhibitor |
| CAS | 1613724-42-7 |
| MW: | 468.6 D |
ab 100,00 €
WZ4003
Artikelnummer: Cay19177-1
NUAK1 (also known as AMPK-related kinase 5) and NUAK2 (also known as SNF1/AMPK-related kinase) are members of the AMP-activated protein kinase (AMPK) family of protein kinases that are activated by the liver kinase B1 tumor suppressor kinase. NUAK kinases are thought to have roles in regulating cell adhesion, cancer...
| Schlagworte: | N-[3-[[5-chloro-2-[[2-methoxy-4-(4-methyl-1-piperazinyl)phenyl]amino]-4-pyrimidinyl]oxy]phenyl]-propanamide |
| Anwendung: | Selective NUAK1 / NUAK2 inhibitor |
| CAS | 1214265-58-3 |
| MW: | 497 D |
ab 44,00 €
Anti-ARK5 / NUAK1, Internal
Artikelnummer: ARG64833.100
Protein function: Serine/threonine-protein kinase involved in various processes such as cell adhesion, regulation of cell ploidy and senescence, cell proliferation and tumor progression. Phosphorylates ATM, CASP6, LATS1, PPP1R12A and p53/TP53. Acts as a regulator of cellular senescence and cellular ploidy by...
| Schlagworte: | Anti-ARK5, Anti-NUAK1, EC=2.7.11.1, Anti-Omphalocele kinase 1, Anti-AMPK-related protein kinase 5, Anti-NUAK family... |
| Anwendung: | ELISA, WB |
| Wirt: | Goat |
| Spezies-Reaktivität: | human |
822,00 €
Anti-ARK5
Artikelnummer: NSJ-R35382-100UG
0.5 mg/ml in 1X TBS, pH7.3, with 0.5% BSA (US sourced) and 0.02% sodium azide. Additional name(s) for this target protein: AMPK-related protein kinase 5, NUAK1 Protein function: Serine/threonine-protein kinase involved in various processes such as cell adhesion, regulation of cell ploidy and senescence, cell...
| Schlagworte: | Anti-ARK5, Anti-NUAK1, EC=2.7.11.1, Anti-Omphalocele kinase 1, Anti-AMPK-related protein kinase 5, Anti-NUAK family... |
| Anwendung: | WB, ELISA (peptide) |
| Wirt: | Goat |
| Spezies-Reaktivität: | human |
790,00 €
Anti-NUAK1
Artikelnummer: E-AB-16173.120
NUAK family SNF1-like kinase 1 also known as AMPK-related protein kinase 5 (ARK5) is an enzyme that in humans is encoded by the NUAK1 gene. Serine/threonine-protein kinase involved in various processes such as cell adhesion, regulation of cell ploidy and senescence, cell proliferation and tumor progression....
| Schlagworte: | Anti-ARK5, Anti-NUAK1, EC=2.7.11.1, Anti-Omphalocele kinase 1, Anti-AMPK-related protein kinase 5, Anti-NUAK family... |
| Anwendung: | IHC, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 89,00 €
ON-123300
Artikelnummer: Cay19902-1
ON-123300 is a multi-kinase inhibitor. It inhibits ARK5, Cdk4, and Cdk6 (IC50s = 3.87, 9.82, and 4.95 nM, respectively) as well as FYN, PDGFRbeta, Abl, and PI3Kdelta (IC50s = 11.09, 26, 53.32, and 144 nM, respectively) among others. It inhibits proliferation in a panel of 38 cancer cell lines (GI50s = 0.05-5 µM)....
| Schlagworte: | 8-cyclopentyl-7,8-dihydro-2-[[4-(4-methyl-1-piperazinyl)phenyl]amino]-7-oxo-pyrido[2,3-d]pyrimidine-6-carbonitrile |
| Anwendung: | CDK inhibitor |
| CAS | 1357470-29-1 |
| MW: | 429.5 D |
ab 52,00 €
Anti-NUAK1
Artikelnummer: E-AB-12986.120
NUAK family SNF1-like kinase 1 also known as AMPK-related protein kinase 5 (ARK5) is an enzyme that in humans is encoded by the NUAK1 gene. Serine/threonine-protein kinase involved in various processes such as cell adhesion, regulation of cell ploidy and senescence, cell proliferation and tumor progression....
| Schlagworte: | Anti-ARK5, Anti-NUAK1, EC=2.7.11.1, Anti-Omphalocele kinase 1, Anti-AMPK-related protein kinase 5, Anti-NUAK family... |
| Anwendung: | IHC, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 89,00 €
Anti-NUAK2
Artikelnummer: ATA-HPA008958.100
Protein function: Stress-activated kinase involved in tolerance to glucose starvation. Induces cell-cell detachment by increasing F-actin conversion to G-actin. Expression is induced by CD95 or TNF-alpha, via NF-kappa-B. Protects cells from CD95-mediated apoptosis and is required for the increased motility and...
| Schlagworte: | Anti-SNARK, Anti-OMPHK2, EC=2.7.11.1, Anti-Omphalocele kinase 2, Anti-SNF1/AMP kinase-related kinase, Anti-NUAK family... |
| Anwendung: | WB, IHC, ICC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 320,00 €