Zu "K08524" wurden 41 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
BMS 649
Artikelnummer: Cay30037-10
BMS 649 is a synthetic retinoid and retinoid X receptor (RXR) agonist. It binds to RXRalpha homodimers and selectively induces transactivation in CV-1 cells expressing RXRalpha over CV-1 cells expressing retinoic acid receptor alpha (RARalpha), RARbeta, or RARalpha and RXRalpha when used at a concentration of 0.1...
| Schlagworte: | BMS 188649, SR 11237, UVI 2108, 4-[2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1,3-dioxolan-2-yl]-benzoic acid |
| Anwendung: | Synthetic retinoid, RXR agonist |
| CAS | 146670-40-8 |
| MW: | 380.5 D |
ab 134,00 €
V-125
Artikelnummer: TGM-T70165-100mg
Description: V-125 is an agonist of retinoid X receptors. Target: Others. Smiles: CC1(C)C=2C(=CC(C)=C(N(CC)C3=CC=C(C(O)=O)C=N3)C2)C(C)(C)CC1
| Anwendung: | RXR agonist |
| CAS | 1807740-94-8 |
| MW: | 366.5 D |
ab 86,00 €
UVI 3003
Artikelnummer: TGM-T17209-100mg
Description: UVI 3003 is a highly selective antagonist of the retinoid X receptor, inhibiting Xenopus and human RXRalpha in Cos7 cells with IC50 values of 0.22 µM and 0.24 µM, respectively. Target: Retinoid Receptor, Autophagy. Smiles: CCCCCOc1cc2c(cc1-c1cc(\C=C\C(O)=O)ccc1O)C(C)(C)CCC2(C)C. References: Zhu J, et...
| Anwendung: | RXR antagonist |
| CAS | 847239-17-2 |
| MW: | 436.58 D |
ab 31,00 €
CD3254
Artikelnummer: TGM-T14912-1mg
Description: CD3254 is a selective and potent retinoid X receptor-like (RXR) agonist that inhibits neuronal cell death with OGD/reoxygenation. Target: Retinoid Receptor. Smiles: Cc1cc2c(cc1-c1cc(\C=C/C(O)=O)ccc1O)C(C)(C)CCC2(C)C. References: Nahoum V, et al. Modulators of the structural dynamics of the retinoid X...
| Anwendung: | Selective RXR alpha agonist |
| CAS | 196961-43-0 |
| MW: | 364.48 D |
50,00 €
CD3254
Artikelnummer: Cay20870-1
CD3254 is a selective agonist of the retinoid X receptors (RXRs, EC50 = ~10 nM for human RXRbeta) that is without effect on retinoic acid receptors (RARs). It stimulates the recruitment of the nuclear receptor interaction domain of the TRAP220 coactivator to RXRalpha/RARbeta heterodimers in vitro. CD3254 also...
| Schlagworte: | 3-[4-hydroxy-3-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)phenyl]-2-propenoic acid |
| Anwendung: | Selective RXR alpha agonist |
| CAS | 196961-43-0 |
| MW: | 364.5 D |
ab 44,00 €
RXRalpha (human) Reporter Assay Kit
Artikelnummer: IB-IB00801
This nuclear receptor assay system utilizes proprietary non-human cells engineered to provide constitutive, high-level expression of the human retinoid X receptor alpha (NR2B1), a ligand-dependent transcription factor commonly referred to as RXRA or RXRalpha. INDIGO's reporter cells include the luciferase reporter...
| Schlagworte: | RXRA, NR2B1, Retinoid X receptor alpha, Retinoic acid receptor RXR-alpha, Nuclear receptor subfamily 2 group B member 1 |
| Anwendung: | Functional activity screening |
| Spezies-Reaktivität: | human |
ab 1.448,00 €
HX 531
Artikelnummer: Cay20762-10
HX 531 is an antagonist of the retinoid X receptor (RXR) with an IC50 value of 18 nM that inhibits 9-cis retinoic acid (Cay-14587)-induced transactivation of RXR. It has been shown to reduce triglyceride content in white adipose tissue, skeletal muscle, and the liver of mice on a high fat diet.Formal Name:...
| Schlagworte: | 4-(7,8,9,10-tetrahydro-5,7,7,10,10-pentamethyl-2-nitro-5H-benzo[b]naphtho[2,3-e][1,4]diazepin-12-yl)-benzoic acid |
| Anwendung: | RXR antagonist |
| CAS | 188844-34-0 |
| MW: | 483.6 D |
ab 43,00 €
9-cis-Retinoic acid
Artikelnummer: LKT-R1777.5
A vitamin A analog that inhibits cell proliferation and induces cell differentiation.
| Schlagworte: | Alitretinoin |
| Anwendung: | Chemopreventive agent, Retinoid receptor agonist |
| CAS | 5300-03-8 |
| MW: | 300,44 D |
ab 102,00 €
all-trans Retinoic Acid
Artikelnummer: Cay11017-5
all-trans Retinoic acid is a metabolite of vitamin A and a ligand for retinoic acid receptors (RARs) with IC50 values of 9, 3, and 10 nM for RARalpha, RARbeta, and RARgamma, respectively, in radioligand binding assays. It induces expression of a luciferase reporter in COS-7 cells expressing RARalpha, RARbeta, or...
| Schlagworte: | atRA, NSC 122578, NSC 122758, RA, Vitamin A Acid,... |
| Anwendung: | RAR / RXR ligand |
| CAS | 302-79-4 |
| MW: | 300.4 D |
ab 48,00 €
-30 %
Rabattaktion
Anti-RXR alpha
Artikelnummer: ARG63678.100
Protein function: Receptor for retinoic acid. Retinoic acid receptors bind as heterodimers to their target response elements in response to their ligands, all-trans or 9-cis retinoic acid, and regulate gene expression in various biological processes. The RAR/RXR heterodimers bind to the retinoic acid response...
| Schlagworte: | Anti-RXRA, Anti-NR2B1, Anti-Retinoid X receptor alpha, Anti-Retinoic acid receptor RXR-alpha, Anti-Nuclear receptor... |
| Anwendung: | ELISA, WB |
| Wirt: | Goat |
| Spezies-Reaktivität: | human |
536,00 €
ab 375,20 €
Mouse Rxr alpha / Retinoic acid receptor RXR-alpha ELISA...
Artikelnummer: G-MOFI00520.96
| Anwendung: | ELISA |
| Spezies-Reaktivität: | mouse |
694,00 €
RXRalpha (human) Reporter Assay Kit
Artikelnummer: IB-IB00802
This nuclear receptor assay system utilizes proprietary non-human cells engineered to provide constitutive, high-level expression of the human retinoid X receptor alpha (NR2B1), a ligand-dependent transcription factor commonly referred to as RXRA or RXRalpha. INDIGO's reporter cells include the luciferase reporter...
| Schlagworte: | RXRA, NR2B1, Retinoid X receptor alpha, Retinoic acid receptor RXR-alpha, Nuclear receptor subfamily 2 group B member 1 |
| Anwendung: | Functional activity screening |
| Spezies-Reaktivität: | human |
3.802,00 €