Zu "K05692" wurden 220 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Latrunculin A
Artikelnummer: Cay10010630-100
Actin disruption is used to study cell functions in vitro (e.g., migration, endocytosis) and in vivo (e.g., tumor cell invasion). Latrunculin A is a bioactive 2-thiazolidinone macrolide derived from sponges that sequesters G-actin and prevents F-actin assembly. It binds monomeric actin with 1:1 stoichiometry and can...
| Schlagworte: | NSC 613011,... |
| Anwendung: | Actin polymerization inhibitor |
| CAS | 76343-93-6 |
| MW: | 421.6 D |
ab 66,00 €
Cytochalasin D
Artikelnummer: Cay11330-1
The cytochalasins are cell-permeable fungal metabolites that inhibit actin polymerization. This interferes with such diverse processes as cell movement, growth, phagocytosis, degranulation, and secretion. Cytochalasin D is a cell-permeable inhibitor that binds actin filaments, but not actin monomers, to inhibit...
| Schlagworte: | NSC 209835,... |
| Anwendung: | Cell-permeable actin polymerization inhibitor |
| CAS | 22144-77-0 |
| MW: | 507.6 D |
ab 83,00 €
Jasplakinolide
Artikelnummer: Cay11705-50
Jasplakinolide is a natural macrocyclic peptide first isolated from a marine sponge. It potently inhibits the proliferation of PC3 prostate carcinoma cells (IC50 = 35 nM) by binding F-actin (KD = 15 nM). This binding of jasplakinolide to actin, which is competitive with phalloidin, stabilizes actin filaments in...
| Schlagworte: | NSC 613009,... |
| Anwendung: | Actin studies |
| CAS | 102396-24-7 |
| MW: | 709.7 D |
ab 228,00 €
Cytochalasin B
Artikelnummer: Cay11328-10
Cytochalasin B is a cell-permeable mycotoxin which binds to the barbed end of actin, reversibly inhibiting the elongation and shortening of actin filaments. By disrupting actin polymerization, cytochalasin B blocks diverse cellular functions, including cell division, migration, phagocytosis, exocytosis, chemotaxis,...
| Schlagworte: | NSC 107658, Phomin,... |
| Anwendung: | Mycotoxin |
| CAS | 14930-96-2 |
| MW: | 479.6 D |
ab 60,00 €
Latrunculin B
Artikelnummer: AG-CN2-0031-M001
Isolated from Latrunculia magnifica. Cell permeable marine toxin. Disrupts microfilament-mediated processes. Actin polymerization inhibitor in vitro and in vivo by the formation of a 1:1 complex with monomeric G-actin. Less potent than Latrunculin A. May have fewer unwanted effects than latrunculin A and may be...
| Schlagworte: | LAT-B, NSC 339663 |
| Anwendung: | Actin polymerization inhibitor |
| CAS | 76343-94-7 |
| MW: | 395,5 D |
ab 143,00 €
Cytochalasin E
Artikelnummer: TGM-T15039-10mg
Description: Cytochalasin E is a potent actin depolymerization agent and an epoxide containing Aspergillus-derived fungal metabolite. Cytochalasin E also inhibits angiogenesis and tumor growth. It binds and caps the barbed end of actin filaments to prevent actin elongation. Target: Others. Smiles:...
| Anwendung: | Actin polymerisation inhibitor |
| CAS | 36011-19-5 |
| MW: | 495.56 D |
ab 164,00 €
Latrunculin A
Artikelnummer: TGM-T15721-1mg
Description: Latrunculin A is a toxin isolated from the red sea sponge Latrunculia magnifica. Latrunculin A binds to actin monomers and it also inhibits polymerization of actin (Kds: 0.1, 0.4, 4.7 µM, and 0.19 µM for ATP-actin, ADP-Pi-actin, ADP-actin, and G-actin, respectively). Target: Others. Smiles:...
| Schlagworte: | LAT-A |
| Anwendung: | Actin polymerization inhibitor |
| CAS | 76343-93-6 |
| MW: | 421.55 D |
2.313,00 €
Cytochalasin H
Artikelnummer: TGM-T21513-1mg
Description: Cytochalasin H ((16-Benzyl-5,12-dihydroxy-5,7,14-trimethyl-13-methylidene-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9-dien-2-yl) acetate) is a potent inhibitor of actin incorporation into filaments. Target: MMP. Smiles:...
| Schlagworte: | (16-Benzyl-5,12-dihydroxy-5,7,14-trimethyl-13-methylidene-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9-dien-2-yl) acetate |
| Anwendung: | Actin polymerization inhibitor |
| CAS | 53760-19-3 |
| MW: | 493.63 D |
ab 162,00 €
Latrunculin B
Artikelnummer: TGM-T20636-1mg
Description: Latrunculin B, an alkaloid from the Red Sea sponge, is an actin polymerization inhibitor with antifungal and antiprotozoal activity.Latrunculin B modulates the electrophysiological characteristics of the pulmonary veins and attenuates the occurrence of torsade de pointes, and may be used in the study of...
| Schlagworte: | NSC 339663, NSC339663, NSC-339663, LAT-B, LATB, INS115644, LAT B |
| Anwendung: | Actin polymerization inhibitor |
| CAS | 76343-94-7 |
| MW: | 395.51 D |
536,00 €
Cytochalasin D
Artikelnummer: TGM-T3229-1mg
Description: Cytochalasin D is an actin inhibitor, the removal of actin stress fibers is crucial for the chondrogenic differentiation. It may be an inhibitor of some fertilization processes such as sperm penetration or sperm head decondensation. Cytochalasin D inhibits CT26 tumor growth potentially through...
| Anwendung: | Cell-permeable actin polymerization inhibitor |
| CAS | 22144-77-0 |
| MW: | 507.62 D |
339,00 €
Phallacidin
Artikelnummer: TGM-T40298-1mg
Description: Phallacidin, a phallotoxin family member, targets and binds to F-actin in mushroom toxins. Target: Others. Smiles: [H][C@@]12C[C@H](O)CN1C(=O)[C@]1([H])CSc3[nH]c4ccccc4c3C[C@]([H])(NC(=O)[C@H](C)NC2=O)C(=O)N[C@@H](CC(C)(O)CO)C(=O)N[C@@H](C(C)C)C(=O)N[C@]([H])([C@H](O)C(O)=O)C(=O)N1. References: L S...
| Anwendung: | Actin fiber binding, carboxyl group for coupling reactions |
| CAS | 26645-35-2 |
| MW: | 846.91 D |
524,00 €
Cucurbitacin E
Artikelnummer: TGM-T5S1467-100mg
Description: Cucurbitacin E is a natural product isolated from the climbing stem of Cucumic melo L. It significantly suppresses the activity of the cyclin B1/CDC2 complex.Cucurbitacin E has prevention of neurodegeneration, it has potent anti-proliferative, antineoplastic, anti-inflammatory and analgesic actions....
| Anwendung: | Actin depolymerization inhibitor |
| CAS | 18444-66-1 |
| MW: | 556.69 D |
ab 53,00 €