Zu "K04977" wurden 25 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-(p-amylcinnamoyl) Anthranilic Acid
Artikelnummer: TGM-T5454-50mg
Description: N-(p-amylcinnamoyl) Anthranilic Acid (ACA) is a broad-spectrum Phospholipase A2 (PLA2) inhibitor and a TRP channel blocker. Target: TRP/TRPV Channel, Phospholipase. Smiles: CCCCCc1ccc(\C=C\C(=O)Nc2ccccc2C(O)=O)cc1. References: Kraft R, et al. Inhibition of TRPM2 cation channels by...
| Schlagworte: | ACA |
| Anwendung: | TRP channel blocker |
| CAS | 110683-10-8 |
| MW: | 337.41 D |
ab 39,00 €
Anti-TRPM2
Artikelnummer: CSB-PA113579.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: TRPM2. Antigen Species: Human
| Schlagworte: | Anti-TRPM2, Anti-TrpC7, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 163,00 €
Anti-TRPM2
Artikelnummer: CSB-PA567120.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: TRPM2. Antigen Species: Human
| Schlagworte: | Anti-TRPM2, Anti-TrpC7, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 163,00 €
Anti-TRPM2
Artikelnummer: A300-414A
Protein function: Isoform 1: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771, PubMed:20660597,...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 164,00 €
N-(p-amylcinnamoyl) Anthranilic Acid
Artikelnummer: Cay14531-25
N-(p-amylcinnamoyl) Anthranilic acid (ACA) is a channel blocker that acts on several transient receptor potential (TRP) channels, including TRPM2, TRPM8, and TRPC6 (IC50 = 1.7, 3.8, and 2.3 µM, respectively). It is a weak inhibitor of TRPV1. ACA is also an inhibitor of phospholipase A2, blocking the release of...
| Schlagworte: | ACA, 2-[[1-oxo-3-(4-pentylphenyl)-2-propen-1-yl]amino]-benzoic acid |
| Anwendung: | TRP channel blocker |
| CAS | 110683-10-8 |
| MW: | 337.4 D |
ab 84,00 €
Cyclic ADP-Ribose (ammonium salt)
Artikelnummer: Cay21417-1
Cyclic ADP-ribose (cADP-ribose) is an endogenous metabolite of NAD+ that mobilizes the release of stored Ca2+ in the endoplasmic reticulum via ryanodine receptors in various cell types.{12737, 11940, 20368, 34320, 34319} This second messenger is generated via the cADP-ribose synthases CD38 and CD157.{20368, 34319,...
| Schlagworte: | cADPR, cADP-Ribose, 1-beta-D-ribofuranosyl-adenosine 5'-(trihydrogen diphosphate), intramol. P',5''-ester, diammonium salt |
| Anwendung: | Endogenous NAD+ metabolite, second messenger |
| MW: | 575.4 D |
ab 272,00 €
Anti-TRPM2
Artikelnummer: E-AB-61822.120
The protein encoded by this gene forms a tetrameric cation channel that is permeable to calcium, sodium, and potassium and is regulated by free intracellular ADP-ribose. The encoded protein is activated by oxidative stress and confers susceptibility to cell death. Alternative splicing results in multiple transcript...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 198,00 €
-30 %
Rabattaktion
Anti-TRPM2
Artikelnummer: ARG40778.50
Protein function: Isoform 1: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771, PubMed:20660597,...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | IHC (paraffin), WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
520,00 €
364,00 €
-30 %
Rabattaktion
Anti-TRPM2
Artikelnummer: ARG40825.100
Protein function: Isoform 1: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771, PubMed:20660597,...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | ICC, IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | mouse, rat |
624,00 €
436,80 €
Anti-TRPM2
Artikelnummer: ATA-HPA030976.100
Protein function: [Isoform 1]: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771,...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | ICC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 300,00 €
Anti-TRPM2
Artikelnummer: ATA-HPA035260.100
Protein function: [Isoform 1]: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771,...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 300,00 €
Anti-TRPM2 / EREG1
Artikelnummer: NSJ-RQ6967
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Transient receptor potential cation channel subfamily M member 2 (TRPM2), also known as Estrogen-responsive element-associated gene 1 (EREG1), is a protein that in humans is encoded by the TRPM2 gene. Using a cosmid/BAC contig, this gene is mapped to chromosome...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | WB, FC, Direct ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
755,00 €