Zu "K04802" wurden 140 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PCNA antibody
Artikelnummer: ABS-KC-800.100
Protein function: Auxiliary protein of DNA polymerase delta and is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'- phosphodiesterase, but not...
| Schlagworte: | Anti-Proliferating cell nuclear antigen, Anti-PCNA, Anti-Cyclin, PCNA antibody |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-PCNA
Artikelnummer: ABS-KC-801.100
Protein function: Auxiliary protein of DNA polymerase delta and is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'- phosphodiesterase, but not...
| Schlagworte: | Anti-Proliferating cell nuclear antigen, Anti-PCNA, Anti-Cyclin, PCNA Antibody |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-PCNA
Artikelnummer: ABS-KC-802.100
Protein function: Auxiliary protein of DNA polymerase delta and is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'- phosphodiesterase, but not...
| Schlagworte: | Anti-Proliferating cell nuclear antigen, Anti-PCNA, Anti-Cyclin, PCNA Antibody |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-PCNA
Artikelnummer: ABS-OC-096.100
Protein function: Auxiliary protein of DNA polymerase delta and is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'- phosphodiesterase, but not...
| Schlagworte: | Anti-Proliferating cell nuclear antigen, Anti-PCNA, Anti-Cyclin, PCNA Antibody |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-PCNA, clone 9C6
Artikelnummer: E-AN005350L.100
Auxiliary protein of DNA polymerase delta and epsilon, is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'-phosphodiesterase, but not apurinic-apyrimidinic...
| Schlagworte: | Anti-PCNA, Anti-Cyclin, Anti-Proliferating cell nuclear antigen, PCNA Monoclonal Antibody |
| Anwendung: | WB, IP, IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human,mouse,rat |
ab 61,00 €
Anti-HRP-conjugated PCNA, clone 9C6
Artikelnummer: E-AN00472HP.100
Auxiliary protein of DNA polymerase delta and epsilon, is involved in the control of eukaryotic DNA replication by increasing the polymerase's processibility during elongation of the leading strand. Induces a robust stimulatory effect on the 3'-5' exonuclease and 3'-phosphodiesterase, but not apurinic-apyrimidinic...
| Schlagworte: | Anti-PCNA, Anti-Cyclin, Anti-Proliferating cell nuclear antigen, HRP-conjugated PCNA Monoclonal Antibody |
| Anwendung: | WB |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human,mouse,rat |
ab 73,00 €
AOH1996
Artikelnummer: TGM-T77520-100mg
Description: AOH1996 is an orally active ligand for the replicasome component PCNA (proliferating cell nuclear antigen), targeting the transcription-replication conflict (TRC). It interferes with the interaction of PCNA with its binding proteins, leading to DNA replication stress and apoptosis. AOH1996 causes...
| Anwendung: | PCNA inhibitor |
| CAS | 2089314-64-5 |
| MW: | 426.46 D |
ab 60,00 €
T2AA hydrochloride
Artikelnummer: TGM-T85298-10mg
Description: T2AA, a proliferating cell nuclear antigen (PCNA) inhibitor, disrupts protein-protein interactions between PCNA and both a PIP-box-containing peptide (IC50= 1 µM) and full-length p21, reducing cellular colocalization of PCNA with DNA polymerase delta. This compound effectively inhibits DNA replication...
| Schlagworte: | T2-amino Alcohol |
| Anwendung: | PCNA/ PIP-Box interaction inhibitor |
| CAS | 2138331-07-2 |
| MW: | 547.6 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
PCNA-I1
Artikelnummer: TGM-T8955-100mg
Description: PCNA-I1 is an inhibitor targeting PCNA chromatin association in prostate cancer. Target: Others. Smiles: Cc1ccsc1C(=O)N\N=C\c1ccc2ccccc2c1O. References: Dillehay K L , Lu S , Dong Z . Antitumor Effects of a Novel Small Molecule Targeting PCNA Chromatin Association in Prostate Cancer[J]. Molecular Cancer...
| Anwendung: | PCNA chromatin association inhibitor |
| CAS | 444930-42-1 |
| MW: | 310.37 D |
ab 81,00 €
PCNA Protein, Human, Recombinant (His)
Artikelnummer: TGM-TMPY-02543-100ug
Description: Proliferating Cell Nuclear Antigen (PCNA) is a protein only expressed in normal proliferate cells and cancer cells. It is central to both DNA replication and repair. One of the well-established functions for PCNA is its role as the processivity factor for DNA polymerase delta and epsilon. PCNA tethers...
| Schlagworte: | ATLD2, proliferating cell nuclear antigen |
| MW: | 31 kD |
699,00 €
Anti-PCNA Monoclonal
Artikelnummer: CSB-MA000186.100
Host Species: Mouse. Isotype: IgG. Buffer: PBS, pH 7.4, containing 0.02% sodium azide as Preservative and 50% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from mouse ascites by affinity-chromatography using specific...
| Schlagworte: | Anti-PCNA, Anti-Cyclin, Anti-Proliferating cell nuclear antigen, PCNA, Proliferating cell nuclear antigen, PCNA, Cyclin,... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human, mouse, rat |
ab 126,00 €
Anti-PCNA
Artikelnummer: CSB-PA003719.100
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Schlagworte: | Anti-PCNA, Anti-Cyclin, Anti-Proliferating cell nuclear antigen, ATLD2 antibody, cb16 antibody, Cyclin antibody, DNA... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat, monkey |
ab 126,00 €