Zu "K04377" wurden 211 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-c-myc, HRP conjugated
Artikelnummer: A190-105P
Protein function: Transcription factor that binds DNA in a non-specific manner, yet also specifically recognizes the core sequence 5'- CAC[GA]TG-3'. Activates the transcription of growth-related genes. [The UniProt Consortium]
| Schlagworte: | Anti-MYC, Anti-bHLHe39, Anti-BHLHE39, Anti-Proto-oncogene c-Myc, Anti-Transcription factor p64, Anti-Myc proto-oncogene... |
| Anwendung: | WB, IHC, ICC, ELISA |
| Wirt: | Rabbit |
507,00 €
Anti-c-myc
Artikelnummer: S190-104
Protein function: Transcription factor that binds DNA in a non-specific manner, yet also specifically recognizes the core sequence 5'- CAC[GA]TG-3'. Activates the transcription of growth-related genes. [The UniProt Consortium]
| Schlagworte: | Anti-MYC, Anti-bHLHe39, Anti-BHLHE39, Anti-Proto-oncogene c-Myc, Anti-Transcription factor p64, Anti-Myc proto-oncogene... |
| Anwendung: | IP |
| Wirt: | Goat |
483,00 €
Anti-Myc Tag
Artikelnummer: ABS-KC-476.100
Protein function: Transcription factor that binds DNA in a non-specific manner, yet also specifically recognizes the core sequence 5'-CAC[GA]TG-3'. Activates the transcription of growth-related genes. Binds to the VEGFA promoter, promoting VEGFA production and subsequent sprouting angiogenesis (PubMed:24940000)....
| Schlagworte: | Anti-Myc proto-oncogene protein, Anti-Class E basic helix-loop-helix protein 39, Anti-bHLHe39, Anti-Proto-oncogene c-Myc,... |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 232,00 €
Anti-Myc Tag Magnetic Beads
Artikelnummer: ABS-MB-001.1
Protein function: Transcription factor that binds DNA in a non-specific manner, yet also specifically recognizes the core sequence 5'-CAC[GA]TG-3'. Activates the transcription of growth-related genes. Binds to the VEGFA promoter, promoting VEGFA production and subsequent sprouting angiogenesis (PubMed:24940000)....
| Schlagworte: | Anti-Myc proto-oncogene protein, Anti-Class E basic helix-loop-helix protein 39, Anti-bHLHe39, Anti-Proto-oncogene c-Myc,... |
| Anwendung: | IP |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 252,00 €
Anti-c-myc
Artikelnummer: A190-104A
Protein function: Transcription factor that binds DNA in a non-specific manner, yet also specifically recognizes the core sequence 5'- CAC[GA]TG-3'. Activates the transcription of growth-related genes. [The UniProt Consortium]
| Schlagworte: | Anti-MYC, Anti-bHLHe39, Anti-BHLHE39, Anti-Proto-oncogene c-Myc, Anti-Transcription factor p64, Anti-Myc proto-oncogene... |
| Anwendung: | WB, IP, ICC, ELISA |
| Wirt: | Goat |
390,00 €
KJ Pyr 9
Artikelnummer: TGM-T15665-100mg
Description: KJ Pyr 9 is an MYC inhibitor (Kd: 6.5 nM in vitro assay). Target: c-Myc, Autophagy. Smiles: NC(=O)c1ccc(cc1)-c1cc(nc(c1)-c1ccc(cc1)[N+]([O-])=O)-c1ccco1. References: Hart JR, et al. Inhibitor of MYC identified in a Kr?hnke pyridine library. Proc Natl Acad Sci U S A. 2014 Aug 26,111(34):12556-61.
| Anwendung: | Cell-permeable c-Myc inhibitor |
| CAS | 581073-80-5 |
| MW: | 385.37 D |
ab 34,00 €
10058-F4
Artikelnummer: TGM-T3048-100mg
Description: 10058-F4 (c-Myc Inhibitor) is a cell-permeable thiazolidinone that specifically inhibits the c-Myc-Max interaction and prevents transactivation of c-Myc target gene expression, induces cell-cycle arrest and apoptosis. Target: Autophagy, c-Myc. Smiles: CCC1=CC=C(\C=C2/SC(=S)NC2=O)C=C1. References: Huang...
| Schlagworte: | c-Myc Inhibitor |
| Anwendung: | c-Myc / Max dimerization inhibitor |
| CAS | 403811-55-2 |
| MW: | 249.35 D |
ab 43,00 €
10074-G5
Artikelnummer: TGM-T3686-100mg
Description: 10074-G5 is an inhibitor of c-Myc-Max dimerization. Target: c-Myc, Autophagy. Smiles: [O-][N+](=O)c1ccc(Nc2ccccc2-c2ccccc2)c2nonc12. References: Yap JL, et al. Bioorg Med Chem Lett. 2013, 23(1):370-4.
| Anwendung: | c-Myc inhibitor |
| CAS | 413611-93-5 |
| MW: | 332.31 D |
ab 37,00 €
c-Myc inhibitor 8
Artikelnummer: TGM-T72619-100mg
Description: C-Myc Inhibitor 8 is an effective compound for cancer research, inhibiting cell viability across a range of cancer types and demonstrating growth suppression in human prostate and lung cancers within mouse models. This inhibitor specifically targets the c-Myc pathway, showcasing its potential utility in...
| Anwendung: | c-Myc inhibitor |
| CAS | 2173505-97-8 |
| MW: | 538.79 D |
ab 1.820,00 €
c-Myc inhibitor 9
Artikelnummer: TGM-T72620-100mg
Description: c-Myc Inhibitor 9 (Compound 332) is an effective c-Myc inhibitor, exhibiting a logEC50 of >6, and demonstrating significant tumor growth inhibition in nude mouse models. This compound is utilized in cancer research. Target: Others. Smiles:...
| Anwendung: | c-Myc inhibitor |
| CAS | 2799717-96-5 |
| MW: | 473.63 D |
ab 1.671,00 €
c-Myc inhibitor 7
Artikelnummer: TGM-T72040-100mg
Description: C-Myc Inhibitor 7, serving as both a c-Myc inhibitor and a multi-target protein degrader, effectively degrades proteins c-MYC, CK1alpha, GSPT1, and IKZF1/2/3 across various tumor cell types. It holds potential for research into diseases associated with high c-Myc expression, including cancer,...
| Anwendung: | c-Myc inhibitor |
| CAS | 2883535-99-5 |
| MW: | 614.65 D |
ab 1.520,00 €
c-Myc Protein, Mouse, Recombinant (GST)
Artikelnummer: TGM-TMPH-02791-100ug
Description: Transcription factor that binds DNA in a non-specific manner, yet also specifically recognizes the core sequence 5'-CAC[GA]TG-3'. Activates the transcription of growth-related genes. Binds to the VEGFA promoter, promoting VEGFA production and subsequent sprouting angiogenesis. Regulator of somatic...
| Schlagworte: | bHLHe39, Class E basic helix-loop-helix protein 39, Transcription factor p64, Proto-oncogene c-Myc, MYC, Myc... |
| MW: | 76.0 kD |
ab 281,00 €