Zu "K04282" wurden 23 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Protirelin
Artikelnummer: TGM-T6956-10mg
Description: Protirelin (Thyroliberin) is a tripeptide that stimulates the release of thyrotropin and prolactin. Target: Thyroid hormone receptor(THR), Endogenous Metabolite. Smiles: C([C@H](CC1=CN=CN1)NC(=O)[C@@H]2CCC(=O)N2)(=O)N3[C@H](C(N)=O)CCC3. References: Van Sinay E,etal.Evolutionarily conserved TRH...
| Schlagworte: | Thyroliberin, TRF, TRH, Synthetic thyrotropin-releasing hormone, pGlu-His-Pro-NH2, Lopremone |
| Anwendung: | Targets thyrotropin-releasing hormone receptor (TRHR) |
| CAS | 24305-27-9 |
| MW: | 362.38 D |
ab 46,00 €
Montirelin
Artikelnummer: TGM-T33480-25mg
Description: Montirelin is an analog of thyrotropin-releasing hormone. Target: Others. Smiles: C([C@H](CC1=CN=CN1)NC(=O)[C@H]2NC(=O)[C@@H](C)SC2)(=O)N3[C@H](C(N)=O)CCC3. References: Fujisawa H, Nishimura T, Kimura K. [Antigenicity study on montirelin hydrate (NS-3)]. J Toxicol Sci. 1995 Dec,20 Suppl 2:341-8....
| Schlagworte: | CNK-603, CNK 602A, NS 3, Montirelinum |
| Anwendung: | Targets thyrotropin-releasing hormone receptor (TRHR) |
| CAS | 90243-66-6 |
| MW: | 408.48 D |
1.520,00 €
Human TRHR Protein, hFc Tag
Artikelnummer: DIM-PME101514.10
Recombinant human TRHR Protein with C-terminal human Fc tag. TRHR(Met1-Gln25) hFc(Glu99-Ala330), Protein function: Receptor for thyrotropin-releasing hormone (TRH). Upon ligand binding, this G-protein-coupled receptor triggers activation of the phosphatidylinositol (IP3)-calcium-protein kinase C (PKC) pathway. [The...
| Schlagworte: | CHNG7, TRH-R |
| Exprimiert in: | Human cells |
| Ursprungsart: | human |
| CAS | 12 |
| MW: | 29.0 kD |
ab 129,00 €
Anti-TRH Receptor
Artikelnummer: NSJ-N1066-100UG
0.5 mg/ml with 0.1 mg/ml BSA (US sourced), 0.05% sodium azide. Thyrotropin-releasing hormone (TRH) is produced by tissues of the nervous system and to a lesser degree, pancreas, testis, adrenal gland and lymphoid organs. There are two types of TRH in rodents, TRH1 and 2, but only TRH1 in humans. In cells of the...
| Schlagworte: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, TRH Receptor Antibody |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 317,00 €
Thyrotropin-Releasing Hormone
Artikelnummer: Cay22917-10
Thyrotropin-releasing Hormone (TRH) is a tropic hormone that stimulates release of thyroid-stimulating hormone (TSH) and prolactin. It binds to the human TRH receptor (TRHR) expressed in CHO cells and to rat TRHR in rat brain membranes (IC50s = 25 and 198 nM, respectively). TRH (1 µM) decreases polyphosphoinositide...
| Schlagworte: | pGlu-His-Pro amide, Thyroliberin, Thyrotropin-Releasing Factor, TRF, TRH, TSH-releasing Hormone,... |
| Anwendung: | TRHR agonist |
| CAS | 24305-27-9 |
| MW: | 362.4 D |
ab 45,00 €
Anti-TRH Receptor
Artikelnummer: ARG59728.100
Protein function: Receptor for thyrotropin-releasing hormone. This receptor is mediated by G proteins which activate a phosphatidylinositol-calcium second messenger system. [The UniProt Consortium]
| Schlagworte: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
616,00 €
Anti-TRHR
Artikelnummer: ATA-HPA055162.100
Protein function: Receptor for thyrotropin-releasing hormone (TRH). Upon ligand binding, this G-protein-coupled receptor triggers activation of the phosphatidylinositol (IP3)-calcium-protein kinase C (PKC) pathway. [The UniProt Consortium] Buffer: 40% glycerol and PBS (pH 7.2). 0.02% sodium azide is added as...
| Schlagworte: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 358,00 €
Anti-TRHR
Artikelnummer: CSB-PA024441LA01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: TRHR. Antigen Species: Human
| Schlagworte: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, Thyroliberin receptor... |
| Anwendung: | ELISA, IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-TRHR, HRP conjugated
Artikelnummer: CSB-PA024441LB01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: TRHR. Antigen Species: Human
| Schlagworte: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, Thyroliberin receptor... |
| Anwendung: | ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-TRHR, Biotin conjugated
Artikelnummer: CSB-PA024441LD01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: TRHR. Antigen Species: Human
| Schlagworte: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, Thyroliberin receptor... |
| Anwendung: | ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-TRHR, FITC conjugated
Artikelnummer: CSB-PA024441LC01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: TRHR. Antigen Species: Human
| Schlagworte: | Anti-TRHR, Anti-TRH-R, Anti-Thyroliberin receptor, Anti-Thyrotropin-releasing hormone receptor, Thyroliberin receptor... |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
TRHR (Vector Vector will be determined during the...
Artikelnummer: CSB-CL024441HU.10
Length: 1197 Sequence: ATGGAAAACG AGACAGTCAG TGAACTGAAC CAAACACAGC TTCAGCCACG AGCAGTGGTG GCCTTAGAAT ACCAGGTGGT CACCATCTTA CTTGTACTCA TTATTTGTGG CCTGGGCATT GTAGGCAACA TCATGGTAGT CCTGGTTGTC ATGAGAACCA AGCACATGAG GACCCCCACA AACTGCTACC TGGTGAGCCT GGCAGTAGCT GATCTCATGG TCTTGGTGGC CGCAGGCCTC CCCAACATAA CAGACAGTAT...
| Schlagworte: | TRHR, TRH-R, Thyroliberin receptor, Thyrotropin-releasing hormone receptor |
| Anwendung: | Molecular biology, clone |
| Spezies-Reaktivität: | human |
176,00 €