Zu "K03345" wurden 33 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SENP2 Protein, Human, Recombinant
Artikelnummer: TGM-TMPJ-01336-10ug
Description: SENP2 is an enzyme that belongs to the peptidase C48 family. SENP2 is a protease that catalyzes two essential functions in the SUMO pathway: processing of full-length SUMO1, SUMO2 and SUMO3 to their mature forms and deconjugation of SUMO1, SUMO2 and SUMO3 from targeted proteins. SUMO1 is a small...
| Schlagworte: | Axam2, SMT3-specific isopeptidase 2, SENP2., KIAA1331, Sentrin-specific protease 2, Sentrin/SUMO-specific protease SENP2 |
| MW: | 29 kD |
ab 35,00 €
NSC632839
Artikelnummer: TGM-T3951-100mg
Description: NSC-632839 (Ubiquitin Isopeptidase Inhibitor II) is a nonselective isopeptidase inhibitor, which inhibits USP2 (EC50: 45±4 µM), USP7 (EC50: 37±1 µM), and SENP2 (EC50: 9.8±1.8 µM). Target: DUB. Smiles: Cl.Cc1ccc(\C=C2/CNC\C(=C/c3ccc(C)cc3)C2=O)cc1. References: Nicholson B, et al. Characterization of...
| Schlagworte: | F6, Ubiquitin Isopeptidase Inhibitor II |
| Anwendung: | USP2 / USP7 / SENP2 inhibitor |
| CAS | 157654-67-6 |
| MW: | 339.86 D |
ab 47,00 €
Anti-SENP2
Artikelnummer: CSB-PA040186.100
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Schlagworte: | Anti-Axam2, Anti-SENP2, Anti-Smt3ip2, Anti-KIAA1331, EC=3.4.22.-, Anti-Sentrin-specific protease 2, Anti-SMT3-specific... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 106,00 €
Anti-SENP2
Artikelnummer: CSB-PA692718.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: SENP2. Antigen Species: Human
| Schlagworte: | Anti-Axam2, Anti-SENP2, Anti-Smt3ip2, Anti-KIAA1331, EC=3.4.22.-, Anti-Sentrin-specific protease 2, Anti-SMT3-specific... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 163,00 €
Anti-SENP2
Artikelnummer: CSB-PA727078.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: SENP2. Antigen Species: Human
| Schlagworte: | Anti-Axam2, Anti-SENP2, Anti-Smt3ip2, Anti-KIAA1331, EC=3.4.22.-, Anti-Sentrin-specific protease 2, Anti-SMT3-specific... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 163,00 €
SUMO-Specific Protease 2 (SENP2)
Artikelnummer: CR-C09010-100UG
Endotoxin level: <1 EU per 1 µg of the protein by the LAL method.
| Exprimiert in: | E.coli |
ab 1.300,00 €
NSC 632839
Artikelnummer: Cay16893-1
Protein ubiquitination is a dynamic process that can be reversed by deubiquitinating enzymes (DUBs) that remove ubiquitin from proteins, sparing them from degradation by the proteasome. The DUBs have been divided into various groups, the largest being the ubiquitin-specific proteases (USPs). NSC 632839 inhibits USP2...
| Schlagworte: | F6, Ubiquitin Isopeptidase Inhibitor II, 3,5-bis[(4-methylphenyl)methylene]-4-piperidinone, monohydrochloride |
| Anwendung: | USP2 / USP7 / SENP2 inhibitor |
| CAS | 157654-67-6 |
| MW: | 339.9 D |
ab 43,00 €
Anti-SENP2
Artikelnummer: ATA-HPA029247.100
Protein function: Protease that catalyzes two essential functions in the SUMO pathway. The first is the hydrolysis of an alpha-linked peptide bond at the C-terminal end of the small ubiquitin-like modifier (SUMO) propeptides, SUMO1, SUMO2 and SUMO3 leading to the mature form of the proteins. The second is the...
| Schlagworte: | Anti-SENP2, Anti-Axam2, Anti-Smt3ip2, Anti-KIAA1331, EC=3.4.22.-, Anti-Sentrin-specific protease 2, Anti-SMT3-specific... |
| Anwendung: | IHC, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 300,00 €
Anti-SENP2
Artikelnummer: ATA-HPA029248.100
Protein function: Protease that catalyzes two essential functions in the SUMO pathway. The first is the hydrolysis of an alpha-linked peptide bond at the C-terminal end of the small ubiquitin-like modifier (SUMO) propeptides, SUMO1, SUMO2 and SUMO3 leading to the mature form of the proteins. The second is the...
| Schlagworte: | Anti-SENP2, Anti-Axam2, Anti-Smt3ip2, Anti-KIAA1331, EC=3.4.22.-, Anti-Sentrin-specific protease 2, Anti-SMT3-specific... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 300,00 €
NEU
Anti-SENP2, FITC conjugated
Artikelnummer: CSB-PA888026LC01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: SENP2. Antigen Species: Human
| Schlagworte: | Anti-Axam2, Anti-SENP2, Anti-Smt3ip2, Anti-KIAA1331, EC=3.4.22.-, Anti-Sentrin-specific protease 2, Anti-SMT3-specific... |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 163,00 €
NEU
Anti-SENP2, Biotin conjugated
Artikelnummer: CSB-PA888026LD01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: SENP2. Antigen Species: Human
| Schlagworte: | Anti-Axam2, Anti-SENP2, Anti-Smt3ip2, Anti-KIAA1331, EC=3.4.22.-, Anti-Sentrin-specific protease 2, Anti-SMT3-specific... |
| Anwendung: | ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 163,00 €
NEU
Anti-SENP2
Artikelnummer: CSB-PA888026LA01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: SENP2. Antigen Species: Human
| Schlagworte: | Anti-Axam2, Anti-SENP2, Anti-Smt3ip2, Anti-KIAA1331, EC=3.4.22.-, Anti-Sentrin-specific protease 2, Anti-SMT3-specific... |
| Anwendung: | ELISA, WB, IHC, IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 163,00 €