Zu "K03237" wurden 57 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
Anti-EIF2S1
Artikelnummer: ABS-KC-2207.100
Protein function: Functions in the early steps of protein synthesis by forming a ternary complex with GTP and initiator tRNA (PubMed:16289705). This complex binds to a 40S ribosomal subunit, followed by mRNA binding to form a 43S pre-initiation complex (PubMed:16289705). Junction of the 60S ribosomal subunit to form...
| Schlagworte: | Anti-Eukaryotic translation initiation factor 2 subunit 1, Anti-Eukaryotic translation initiation factor 2 subunit alpha,... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
NEU
Anti-EIF2S1
Artikelnummer: ABS-KC-6185.100
Protein function: Functions in the early steps of protein synthesis by forming a ternary complex with GTP and initiator tRNA (PubMed:16289705). This complex binds to a 40S ribosomal subunit, followed by mRNA binding to form a 43S pre-initiation complex (PubMed:16289705). Junction of the 60S ribosomal subunit to form...
| Schlagworte: | Anti-Eukaryotic translation initiation factor 2 subunit 1, Anti-Eukaryotic translation initiation factor 2 subunit alpha,... |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human, mouse, rat |
ab 232,00 €
Salubrinal
Artikelnummer: TGM-T3045-2mg
Description: Salubrinal, a phosphatases (PP1) inhibitor(IC50=1.7 µM), exhibits function on the eukaryotic translation initiation factor 2 subunit (eIF2alpha). Target: HSV, Apoptosis, PERK, Phosphatase, Autophagy. Smiles: ClC(Cl)(Cl)C(NC(=S)NC1=CC=CC2=CC=CN=C12)NC(=O)\C=C\C1=CC=CC=C1. References: Boyce M, et al....
| Anwendung: | eIF2alpha dephosphorylation (PP1) inhibitor |
| CAS | 405060-95-9 |
| MW: | 479.81 D |
ab 37,00 €
Anti-EIF2S1
Artikelnummer: CSB-PA002295.50
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Schlagworte: | Anti-EIF2A, Anti-eIF-2A, Anti-eIF-2alpha, Anti-eIF-2-alpha, Anti-Eukaryotic translation initiation factor 2 subunit 1,... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat, monkey |
126,00 €
Anti-Phospho-EIF2S1 (S51)
Artikelnummer: CSB-PA000518.100
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Schlagworte: | Anti-phospho-EIF2A, Anti-phospho-eIF-2A, Anti-phospho-eIF-2alpha, Anti-phospho-eIF-2-alpha, Anti-phospho-Eukaryotic... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 126,00 €
Anti-Phospho-EIF2S1 (Ser49)
Artikelnummer: CSB-PA279986.100
Host Species: Rabbit. Isotype: IgG. Buffer: Supplied at 1.0mg/mL in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antibodies were produced by immunizing rabbits...
| Schlagworte: | Anti-phospho-EIF2A, Anti-phospho-eIF-2A, Anti-phospho-eIF-2alpha, Anti-phospho-eIF-2-alpha, Anti-phospho-Eukaryotic... |
| Anwendung: | ELISA, WB, IHC, IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
340,00 €
Anti-Phospho-EIF2S1 (Ser51)
Artikelnummer: CSB-PA285504.100
Host Species: Rabbit. Isotype: IgG. Buffer: Supplied at 1.0mg/mL in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antibodies were produced by immunizing rabbits...
| Schlagworte: | Anti-phospho-EIF2A, Anti-phospho-eIF-2A, Anti-phospho-eIF-2alpha, Anti-phospho-eIF-2-alpha, Anti-phospho-Eukaryotic... |
| Anwendung: | ELISA, WB, IHC, IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
340,00 €
Anti-EIF2S1 (Ab-51)
Artikelnummer: CSB-PA447773.100
Host Species: Rabbit. Isotype: IgG. Buffer: Supplied at 1.0mg/mL in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antibodies were produced by immunizing rabbits...
| Schlagworte: | Anti-EIF2A, Anti-eIF-2A, Anti-eIF-2alpha, Anti-eIF-2-alpha, Anti-Eukaryotic translation initiation factor 2 subunit 1,... |
| Anwendung: | ELISA, WB, IHC, IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
283,00 €
Salubrinal
Artikelnummer: Cay14735-1
Salubrinal is a selective phosphatase inhibitor that prevents dephosphorylation of eukaryotic translation initiation factor 2 subunit alpha (eIF2alpha), protecting PC12 cells from endoplasmic reticulum stress-mediated apoptosis (EC50 = 15 µM). It appears to block the action of protein phosphatase 1 (PP1) on...
| Schlagworte: | (2E)-3-phenyl-N-[2,2,2-trichloro-1-[[(8-quinolinylamino)thioxomethyl]amino]ethyl]-2-propenamide |
| Anwendung: | eIF2alpha dephosphorylation (PP1) inhibitor |
| CAS | 405060-95-9 |
| MW: | 479.8 D |
ab 36,00 €
Anti-eIF2alpha/EIF2S1
Artikelnummer: A300-721A
Protein function: Functions in the early steps of protein synthesis by forming a ternary complex with GTP and initiator tRNA. This complex binds to a 40S ribosomal subunit, followed by mRNA binding to form a 43S preinitiation complex. Junction of the 60S ribosomal subunit to form the 80S initiation complex is...
| Schlagworte: | Anti-EIF2A, Anti-EIF2S1, Anti-eIF-2A, Anti-eIF-2alpha, Anti-eIF-2-alpha, Anti-Eukaryotic translation initiation factor 2... |
| Anwendung: | WB, IP, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 178,00 €
Sal-003
Artikelnummer: Cay23414-5
Sal-003 dose-dependently prevents dephosphorylation of eukaryotic translation initiation factor 2 subunit alpha (eIF2alpha). It is a more potent derivative of salubrinal (Cay-14735) that increases eIF2alpha phosphorylation in mouse embryonic fibroblasts (MEFs) when used at a concentration of 10 µM. It impairs...
| Schlagworte: | (2E)-3-phenyl-N-[2,2,2-trichloro-1-[[[(4-chlorophenyl)amino]thioxomethyl]amino]ethyl]-2-propenamide |
| Anwendung: | EIF2A dephosphorylation inhibitor |
| CAS | 1164470-53-4 |
| MW: | 463.2 D |
ab 133,00 €
Anti-phospho-eIF2 alpha (Ser51)
Artikelnummer: ARG51760.100
Protein function: Functions in the early steps of protein synthesis by forming a ternary complex with GTP and initiator tRNA. This complex binds to a 40S ribosomal subunit, followed by mRNA binding to form a 43S preinitiation complex. Junction of the 60S ribosomal subunit to form the 80S initiation complex is...
| Schlagworte: | Anti-phospho-EIF2A, Anti-phospho-EIF2S1, Anti-phospho-eIF-2A, Anti-phospho-eIF-2alpha, Anti-phospho-eIF-2-alpha,... |
| Anwendung: | ICC, IF, IHC (paraffin), WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 460,00 €