Zu "K02320" wurden 22 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cytarabine
Artikelnummer: Cay16069-10
Cytarabine (ara-C) is a nucleoside analog and prodrug form of the DNA polymerase inhibitor ara-CTP. It is triphosphorylated to ara-CTP by the successive actions of deoxycytidine kinase, deoxycytidylate kinase, and nucleoside diphosphate kinase. Ara-C inhibits proliferation of HL-60, ML-1, Raji, and Jurkat human...
| Schlagworte: | 1-beta-D-Arabinofuranosylcytosine, NSC 287459, NSC 63878, U-19920A, 4-amino-1-beta-D-arabinofuranosyl-2(1H)-pyrimidinone |
| Anwendung: | Competitive DNA polymerase inhibitor |
| CAS | 147-94-4 |
| MW: | 243.2 D |
ab 67,00 €
POLA1 inhibitor 1
Artikelnummer: TGM-T62176-100mg
Description: POLA1 inhibitor 1 (Compound 12) is an orally active inhibitor of POLA1, displaying antitumor effects on various tumor tissue types and Adaroten-resistant cell lines. Target: Others. Smiles: O\N=C\c1cc(\C=C\C(O)=O)ccc1-c1ccc(O)c(c1)C12CC3CC(CC(C3)C1)C2
| Anwendung: | POLA1 inhibitor |
| CAS | 2217671-41-3 |
| MW: | 417.5 D |
ab 1.521,00 €
Aphidicolin
Artikelnummer: TGM-T14304-1mg
Description: Aphidicolin, an antibiotic derived from the mold Cephalosporium aphidicola, is a potent inhibitor of DNA (deoxyribonucleic acid) synthesis, effectively hindering the proliferation of herpes simplex virus[2]. It targets DNA polymerase alpha and delta, disrupting mitotic cell division by affecting DNA...
| Anwendung: | Eukaryotic nuclear DNA replication inhibitor |
| CAS | 38966-21-1 |
| MW: | 338.48 D |
124,00 €
CX-5461
Artikelnummer: TGM-T2100-1mg
Description: CX-5461, a selective inhibitor of rRNA synthesis, suppresses Pol I-driven transcription of rRNA. Target: DNA/RNA Synthesis. Smiles: CN1CCCN(CC1)c1ccc2c(n1)n1c3ccccc3sc1c(C(=O)NCc1cnc(C)cn1)c2=O. References: Drygin D, et al, Cancer Res, 2011, 71(4), 1418-1430.
| Anwendung: | rRNA synthesis inhibitor |
| CAS | 1138549-36-6 |
| MW: | 513.61 D |
ab 37,00 €
Anti-POLA1
Artikelnummer: CSB-PA002170.50
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Schlagworte: | Anti-POLA, Anti-POLA1, Anti-DNA polymerase alpha catalytic subunit, Anti-DNA polymerase alpha catalytic subunit p180,... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
126,00 €
Anti-POLA1
Artikelnummer: CSB-PA156369.100
Host Species: Rabbit. Isotype: IgG. Buffer: Rabbit IgG in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by...
| Schlagworte: | Anti-POLA, Anti-POLA1, Anti-DNA polymerase alpha catalytic subunit, Anti-DNA polymerase alpha catalytic subunit p180,... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
283,00 €
(+)-Aphidicolin
Artikelnummer: BVT-0307-M005
Antibiotic, Reversible inhibitor of eukaryotic nuclear DNA replication, Useful for cell synchronization, Blocks the cell cycle at early S phase, Prolongs the half life of DNA methyltransferase, Specific DNA polymerase alpha and delta inhibitor in eukaryotic cells and in some viruses of animal origin, Acts...
| Schlagworte: | NSC234714, BRN4689958, ICI69653 |
| Anwendung: | Eukaryotic nuclear DNA replication inhibitor |
| CAS | 38966-21-1 |
| MW: | 338,5 D |
ab 70,00 €
CX-5461
Artikelnummer: Cay18392-1
CX-5461 is an inhibitor of ribosomal RNA (rRNA) synthesis. It selectively inhibits RNA polymerase I-driven transcription of rRNA in HCT116, A375, and MIA PaCa-2 tumor cells (IC50s = 142, 113, and 54 nM, respectively) without affecting RNA polymerase II (IC50 > 25µM), DNA replication, or protein translation. At 50...
| Schlagworte: | 2-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-N-[(5-methyl-2-pyrazinyl)methyl]-5-oxo-5H-benzothiazolo[3,2-a][1,8]naphthyridi... |
| Anwendung: | rRNA synthesis inhibitor |
| CAS | 1138549-36-6 |
| MW: | 513.6 D |
ab 61,00 €
Anti-PolA1
Artikelnummer: A302-851A-T
Protein function: Plays an essential role in the initiation of DNA replication. During the S phase of the cell cycle, the DNA polymerase alpha complex (composed of a catalytic subunit POLA1/p180, a regulatory subunit POLA2/p70 and two primase subunits PRIM1/p49 and PRIM2/p58) is recruited to DNA at the replicative...
| Schlagworte: | Anti-POLA, Anti-POLA1, EC=2.7.7.7, Anti-DNA polymerase alpha catalytic subunit, Anti-DNA polymerase alpha catalytic... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 178,00 €
Aphidicolin
Artikelnummer: LKT-A6229.1
White solid. A DNA polymerase inhibitor. Potentiates apoptosis induced by therapeutic nucleosides.
| Schlagworte: | ICI-69653, NSC-234714 |
| Anwendung: | DNA polymerase inhibitor |
| CAS | 38966-21-1 |
| MW: | 338,48 D |
ab 330,00 €
Cytarabine
Artikelnummer: LKT-C9778.1
Cytarabine is an antimetabolite compound which is proven to be one of the most effective agents available to treat leukemia. It induces its cytotoxic effect by inactivating DNA polymerases alpha, delta, and epsilon and consequently inhibit semi-conservative DNA replication and repair. It also has a potential to...
| Schlagworte: | Ara-C, Arabinofuranosyl Cytidine, cytosine arabinoside |
| Anwendung: | DNA replication inhibitor |
| CAS | 147-94-4 |
| MW: | 243,22 D |
ab 72,00 €
Anti-PolA1
Artikelnummer: A302-850A-T
Protein function: Plays an essential role in the initiation of DNA replication. During the S phase of the cell cycle, the DNA polymerase alpha complex (composed of a catalytic subunit POLA1/p180, a regulatory subunit POLA2/p70 and two primase subunits PRIM1/p49 and PRIM2/p58) is recruited to DNA at the replicative...
| Schlagworte: | Anti-POLA, Anti-POLA1, EC=2.7.7.7, Anti-DNA polymerase alpha catalytic subunit, Anti-DNA polymerase alpha catalytic... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 178,00 €