Zu "K01398" wurden 187 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-MMP2
Artikelnummer: ABS-KC-2458.100
Protein function: Ubiquitinous metalloproteinase that is involved in diverse functions such as remodeling of the vasculature, angiogenesis, tissue repair, tumor invasion, inflammation, and atherosclerotic plaque rupture. As well as degrading extracellular matrix proteins, can also act on several nonmatrix proteins...
| Schlagworte: | Anti-72 kDa type IV collagenase, Anti-72 kDa gelatinase, Anti-Gelatinase A, Anti-Matrix metalloproteinase-2, Anti-MMP-2,... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
MMP2 (human) Antibody Pair
Artikelnummer: ABS-ES-265.50
Protein function: Ubiquitinous metalloproteinase that is involved in diverse functions such as remodeling of the vasculature, angiogenesis, tissue repair, tumor invasion, inflammation, and atherosclerotic plaque rupture. As well as degrading extracellular matrix proteins, can also act on several nonmatrix proteins...
| Schlagworte: | Anti-MMP2, Anti-CLG4A |
| Anwendung: | ELISA |
| Wirt: | Mouse/Mouse |
| Spezies-Reaktivität: | human |
1.080,00 €
MMP2 (human) Antibody Pair
Artikelnummer: ABS-ES-267.50
Protein function: Ubiquitinous metalloproteinase that is involved in diverse functions such as remodeling of the vasculature, angiogenesis, tissue repair, tumor invasion, inflammation, and atherosclerotic plaque rupture. As well as degrading extracellular matrix proteins, can also act on several nonmatrix proteins...
| Schlagworte: | Anti-MMP2, Anti-CLG4A |
| Anwendung: | ELISA |
| Wirt: | Mouse/Mouse |
| Spezies-Reaktivität: | human |
1.080,00 €
Anti-MMP2
Artikelnummer: ABS-KC-6428.100
Protein function: Ubiquitinous metalloproteinase that is involved in diverse functions such as remodeling of the vasculature, angiogenesis, tissue repair, tumor invasion, inflammation, and atherosclerotic plaque rupture. As well as degrading extracellular matrix proteins, can also act on several nonmatrix proteins...
| Schlagworte: | Anti-72 kDa type IV collagenase, Anti-72 kDa gelatinase, Anti-Gelatinase A, Anti-Matrix metalloproteinase-2, Anti-MMP-2,... |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human, mouse |
ab 232,00 €
Anti-MMP-2
Artikelnummer: E-D-AB-10399L.100
Matrix Metalloproteinase-2 (MMP-2) is an enzyme that degrades components of the extracellular matrix and thus plays a pivotal role in cell migration during physiological and pathological processes. MMP-2 expression is dependent on extracellular matrix metalloproteinase inducer (EMMPRIN),Her2/neu,growth...
| Schlagworte: | Anti-MMP2, Anti-CLG4A, MMP-2 Polyclonal Antibody |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | mouse,rat |
ab 109,00 €
Batimastat
Artikelnummer: TGM-T6011-5mg
Description: Batimastat (BB94) (BB-94) is an effective, broad-spectrum matrix metalloprotease (MMP) inhibitor. Batimastat induces extracellular matrix degradation and inhibits angiogenesis, tumor growth and invasion, and metastasis. Target: MMP. Smiles:...
| Schlagworte: | BB94 |
| Anwendung: | Targets matrix metalloproteinase-2 (gelatinase A) [EC:3.4.24.24] (MMP2) |
| CAS | 130370-60-4 |
| MW: | 477.64 D |
ab 48,00 €
SD-2590 HCl
Artikelnummer: TGM-T24775-1mg
Description: SD-2590 HCl is an MMP-2,-3, -9, -8, 13, and -14 inhibitor. Target: Others. Smiles: Cl.O=C(NO)C1(CCN(CCOC)CC1)S(=O)(=O)C2=CC=C(OC3=CC=C(OC(F)(F)F)C=C3)C=C2. References: Becker DP, Barta TE, Bedell LJ, Boehm TL, Bond BR, Carroll J, Carron CP, Decrescenzo GA, Easton AM, Freskos JN, Funckes-Shippy CL, Heron...
| Schlagworte: | SD2590 Hydrochloride, SD 2590 Hydrochloride, SD2590 HCl, SD-2590 Hydrochloride |
| Anwendung: | MMP2 / MMP13 / MMP9 / MMP8 / MMP3 inhibitor |
| CAS | 226395-93-3 |
| MW: | 554.96 D |
ab 108,00 €
ONO 4817
Artikelnummer: TGM-T21814-1mg
Description: ONO-4817 is a broad-spectrum matrix metalloproteinase (MMP) inhibitor that potentially mitigates atherosclerotic neointimal proliferation and atheromatous plaque progression by suppressing matrix metalloproteinases (MMPs). It effectively reduces the development of aortic intimal hyperplasia in...
| Anwendung: | MMP-2 / MMP-9 inhibitor |
| CAS | 223472-31-9 |
| MW: | 416.47 D |
ab 264,00 €
SB-3CT
Artikelnummer: TGM-T2009-1mg
Description: SB-3CT is a potent and specific gelatinase inhibitor for MMP-2 (Ki = 13.9 nM) and MMP-9 (Ki = 600 nM). Target: MMP. Smiles: O=S(=O)(CC1CS1)c1ccc(Oc2ccccc2)cc1. References: Brown S, et al. J Am Chem Soc. 2000, 122 (28), 6799-6800.
| Anwendung: | MMP-2 / MMP-9 inhibitor |
| CAS | 292605-14-2 |
| MW: | 306.4 D |
ab 42,00 €
Ilomastat
Artikelnummer: TGM-T2743-100mg
Description: Ilomastat (GM6001) (GM6001, Galardin) is a broad spectrum matrix metalloprotease (MMP) inhibitor. Target: MMP. Smiles: CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)CC(=O)NO. References: Grobelny D, et al. Biochemistry, 1992, 31(31), 7152-714.
| Schlagworte: | GM6001, Galardin |
| Anwendung: | Targets matrix metalloproteinase-2 (gelatinase A) [EC:3.4.24.24] (MMP2) |
| CAS | 142880-36-2 |
| MW: | 388.46 D |
ab 42,00 €
BPHA
Artikelnummer: TGM-T36712-100mg
Description: BPHA (MMP-2/MMP-9 Inhibitor II) is a potent, selective and orally active inhibitor of MMP-2, MMP-9 and MMP-14 with IC50s of 12 nM, 16 nM and 17 nM, respectively.BPHA does not inhibit MMP-1, -3 and -7 (IC50s of 974, >1000 and 795 nM, respectively).BPHA has anti-angiogenic and BPHA has anti-angiogenic and...
| Schlagworte: | MMP-2/MMP-9 Inhibitor II |
| Anwendung: | MMP2 / MMP9 inhibitor |
| CAS | 193807-60-2 |
| MW: | 396.46 D |
ab 214,00 €
Pyridoxatin
Artikelnummer: TGM-T70891-1mg
Description: Pyridoxatin is a fungal metabolite that inhibits production of thiobarbituric acid reactive substance (TBARS). Pyridoxatin inhibits hemolysis induced by the free radical generator AAPH and is active against C. albicans. Target: Others. Smiles: CC1CC(C)C(C(C1)C=C)c1c(O)ccn(O)c1=O
| Anwendung: | Antibiotic |
| CAS | 135529-30-5 |
| MW: | 263.33 D |
ab 198,00 €