Zu "K01363" wurden 118 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Magic Red(TM) Cathepsin B Assay Kit
Artikelnummer: ICT-937
This kit is based on a cell-permeant fluorescent probe (MR-(RR)2) designed for real-time detection of cathepsin B activity within whole living cells, using a fluorescence microscope. Excitation wavelength 560nm, emission 610-650nm.
| Anwendung: | Real time FM, FC |
296,00 €
Aloxistatin
Artikelnummer: TGM-T6040-100mg
Description: Aloxistatin (E64d) is an inhibitor of cysteine protease with blood platelet aggregation inhibiting activity. Aloxistatin is an irreversible, membrane-permeable inhibitor of lysosomal and cytosolic cysteine proteases with the ability to inhibit calpain activity in intact platelets. Target: SARS-CoV,...
| Schlagworte: | Loxistatin, E64d, E64c ethyl ester |
| Anwendung: | Cathepsin inhibitor |
| CAS | 88321-09-9 |
| MW: | 342.43 D |
ab 36,00 €
Cathepsin B Protein, Human, Recombinant (GST)
Artikelnummer: TGM-TMPH-01059-100ug
Description: Thiol protease which is believed to participate in intracellular degradation and turnover of proteins. Cleaves matrix extracellular phosphoglycoprotein MEPE. Involved in the solubilization of cross-linked TG/thyroglobulin in the thyroid follicle lumen. Has also been implicated in tumor invasion and...
| Schlagworte: | CPSB, APP secretase, CTSB, APPS, Cathepsin B, Cathepsin B1 |
| MW: | 54.6 kD |
ab 193,00 €
Cathepsin B Protein, Human, Recombinant (His)
Artikelnummer: TGM-TMPY-00731-100ug
Description: Cathepsin B Protein, Human, Recombinant (His) is expressed in HEK293 mammalian cells with His tag. The predicted molecular weight is 37.2 kDa and the accession number is A0A024R374.
| Schlagworte: | CPSB, cathepsin B, APPS |
| MW: | 37.2 kD |
ab 261,00 €
Cathepsin B Protein, Mouse, Recombinant (His)
Artikelnummer: TGM-TMPY-02144-50ug
Description: Cathepsin B Protein, Mouse, Recombinant (His) is expressed in HEK293 mammalian cells with His tag. The predicted molecular weight is 36.6 kDa and the accession number is P10605.
| Schlagworte: | cathepsin B, CB |
| MW: | 36.6 kD |
587,00 €
Cathepsin B Protein, Rat, Recombinant (His)
Artikelnummer: TGM-TMPY-04503-50ug
Description: Cathepsin B Protein, Rat, Recombinant (His) is expressed in HEK293 mammalian cells with His tag. The predicted molecular weight is 37.1 kDa and the accession number is F7FAT8.
| Schlagworte: | cathepsin B |
| MW: | 37.1 kD |
686,00 €
Cathepsin Inhibitor 1
Artikelnummer: TGM-T6015-100mg
Description: Cathepsin Inhibitor 1 is an inhibitor of Cathepsin (L, L2, S, K, B) with pIC50 of 7.9, 6.7, 6.0, 5.5 and 5.2, respectively. Target: Cysteine Protease. Smiles: Cn1nc(cc1C(=O)NC(Cc1cccc(Cl)c1)C(=O)NCC#N)C(C)(C)C. References: Asaad N, et al. Bioorg Med Chem Lett, 2009, 19(15), 4280-4283.
| Anwendung: | Cathepsin inhibitor |
| CAS | 225120-65-0 |
| MW: | 401.89 D |
ab 41,00 €
Z-FF-FMK
Artikelnummer: Cay41026-10
Z-FF-FMK is an inhibitor of cathepsin B (Ki = 2.7 nM). It inhibits cell division, cell cycle progression, DNA replication, and chromosome decondensation in isolated T. niger fertilized embryos when used at a concentration of 100 µM. Z-FF-FMK (10 µM) prevents increases in cathepsin L activity induced by amyloid-beta...
| Schlagworte: | Z-FF-Fluoromethyl Ketone, Z-Phe-Phe-CH2F,... |
| Anwendung: | Cathepsin B inhibitor |
| CAS | 105608-85-3 |
| MW: | 462.5 D |
ab 234,00 €
Anti-Cathepsin B (Capture/Detector)
Artikelnummer: E-AN000530P.1
CTSB(Cathepsin B) is also named as CPSB and belongs to the peptidase C1 family. It participates in intracellular degradation and turnover of proteins. Cathepsin B precursors found in human malignant ascites fluid do not possess mannose-rich carbohydrates suggesting that a defect in the post translational processing...
| Schlagworte: | Anti-CTSB, Anti-CPSB, Cathepsin B Polyclonal Antibody(Capture/Detector) |
| Anwendung: | ELISA Capture/Detector |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 129,00 €
CTSB Protein (His Tag) (recombinant mouse)
Artikelnummer: E-PDMM100090.100
Sequence: His18-Asp333. Fusion tag: C-His Endotoxin: < 1.0 EU per µg of the protein as determined by the LAL method Observed Molecular Mass: 40-45 kDa. Protein function: Cathepsin B is a papain-family cysteine protease that is normally located in lysosomes, where it is involved in the turnover of proteins and plays...
| Schlagworte: | Ctsb, Recombinant Mouse CTSB Protein(His Tag) |
| Exprimiert in: | Mammalian |
| Ursprungsart: | mouse |
ab 248,00 €
Val-cit-PAB-OH
Artikelnummer: TGM-T17213-50mg
Description: Val-cit-PAB-OH is an ADC linker that is cleavable. Target: Others, ADC Linker. Smiles: CC(C)[C@H](N)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1
| Anwendung: | Peptide linker molecule, cathepsin B substrate |
| CAS | 159857-79-1 |
| MW: | 379.45 D |
30,00 €
K777
Artikelnummer: TGM-T15641-25mg
Description: K777 is a potent, orally active, and irreversible inhibitor of cysteine protease, functioning as a potent CYP3A4 inhibitor (IC50 = 60 nM) and a selective CCR4 antagonist, which inhibits chemotaxis. K777 irreversibly inhibits Cruzain, the major cysteine protease of Trypanosoma cruzi, and cathepsins B and...
| Schlagworte: | APC-3316 |
| Anwendung: | Potent irreversible cysteine protease inhibitor |
| CAS | 233277-99-1 |
| MW: | 574.73 D |
ab 77,00 €