Zu "K00671" wurden 44 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
IMP-1088
Artikelnummer: Cay25366-1
IMP-1088 is an inhibitor of N-myristoyltransferase 1 (NMT1) and NMT2 (IC50 = 50 = >1,000 nM). It also blocks production of infectious RV-16 virus in primary human bronchial epithelial cells (hBECs) when added 3 hours post infection via inhibition of viral capsid assembly.Formal Name:...
| Schlagworte: | 5-[3,4-difluoro-2-[2-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethoxy]phenyl]-N,N,1-trimethyl-1H-indazole-3-methanamine |
| Anwendung: | NMT1 / NMT2 inhibitor |
| CAS | 2059148-82-0 |
| MW: | 453.5 D |
ab 111,00 €
Myristic acid
Artikelnummer: TGM-T3949-1mL
Description: Myristic acid (Crodacid) , a 14 carbon saturated fatty acid, is a rare molecule in cells and is a substrate of some fatty acid desaturases. This compound has the ability to acylate proteins by covalently binding to the N-terminal glycine residues, in a process called N-terminal myristoylation....
| Schlagworte: | Crodacid, Tetradecanoic acid, n-Tetradecanoic acid |
| Anwendung: | N-myristoylation |
| CAS | 544-63-8 |
| MW: | 228.37 D |
ab 40,00 €
IMP-1088
Artikelnummer: TGM-T9350-10mg
Description: IMP-1088 is a potent inhibitor of human N-myristoyltransferases NMT1 and NMT2 dual. Target: Others, DNA/RNA Synthesis. Smiles: CN(C)Cc1nn(C)c2ccc(cc12)-c1ccc(F)c(F)c1OCCc1c(C)nn(C)c1C. References: Aurélie Mousnier, et al. Fragment-derived Inhibitors of Human N-myristoyltransferase Block Capsid Assembly...
| Anwendung: | NMT1 / NMT2 inhibitor |
| CAS | 2059148-82-0 |
| MW: | 453.53 D |
ab 145,00 €
Anti-NMT2
Artikelnummer: CSB-PA158660.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: NMT2. Antigen Species: Human
| Schlagworte: | Anti-NMT2, Anti-NMT 2, Anti-Type II N-myristoyltransferase, Anti-Peptide N-myristoyltransferase 2, Anti-Glycylpeptide... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 167,00 €
Anti-NMT2
Artikelnummer: CSB-PA213831.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: NMT2. Antigen Species: Human
| Schlagworte: | Anti-NMT2, Anti-NMT 2, Anti-Type II N-myristoyltransferase, Anti-Peptide N-myristoyltransferase 2, Anti-Glycylpeptide... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 167,00 €
Anti-NMT1
Artikelnummer: CSB-PA557232.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: NMT1. Antigen Species: Human
| Schlagworte: | Anti-NMT, Anti-NMT1, Anti-NMT 1, Anti-Type I N-myristoyltransferase, Anti-Peptide N-myristoyltransferase 1,... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
Anti-NMT1
Artikelnummer: CSB-PA904948.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: NMT1. Antigen Species: Human
| Schlagworte: | Anti-NMT, Anti-NMT1, Anti-NMT 1, Anti-Type I N-myristoyltransferase, Anti-Peptide N-myristoyltransferase 1,... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
Myristic Acid
Artikelnummer: Cay13351-1
Myristic acid is a 14-carbon saturated fatty acid. It is incorporated into myristoyl coenzyme A (myristoyl-CoA) and transferred by N-myristoyltransferase to the N-terminal glycine of certain proteins either during translation to modify protein activity or post-translationally in apoptotic cells.Formal Name:...
| Schlagworte: | C14:0, NSC 5028, tetradecanoic acid |
| Anwendung: | N-myristoylation |
| CAS | 544-63-8 |
| MW: | 228.4 D |
ab 21,00 €
Myristoyl-Coenzyme A (sodium salt)
Artikelnummer: Cay39777-5
Myristoyl-coenzyme A (myristoyl-CoA) is a derivative of CoA (Cay-16147) that contains the saturated fatty acid myristic acid (Cay-13351). It is a substrate for N-myristoyltransferase during myristoylation, a process that adds a myristoyl group to proteins either during translation to modify protein activity or...
| Schlagworte: | Myristoyl-CoA, Tetradecanoyl-CoA, S-tetradecanoate coenzyme A, sodium salt |
| Anwendung: | Saturated acyl CoA, N-myristoyltransferase substrate |
| MW: | 977.9 D |
ab 245,00 €
Anti-NMT1
Artikelnummer: A304-253A-T
Protein function: Adds a myristoyl group to the N-terminal glycine residue of certain cellular and viral proteins. [The UniProt Consortium]
| Schlagworte: | Anti-NMT, Anti-NMT1, Anti-NMT 1, Anti-Type I N-myristoyltransferase, Anti-Peptide N-myristoyltransferase 1,... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 178,00 €
Anti-NMT1
Artikelnummer: A304-254A
Protein function: Adds a myristoyl group to the N-terminal glycine residue of certain cellular and viral proteins. [The UniProt Consortium]
| Schlagworte: | Anti-NMT, Anti-NMT1, Anti-NMT 1, Anti-Type I N-myristoyltransferase, Anti-Peptide N-myristoyltransferase 1,... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 178,00 €
Anti-NMT2
Artikelnummer: A304-359A
Protein function: Adds a myristoyl group to the N-terminal glycine residue of certain cellular and viral proteins. [The UniProt Consortium]
| Schlagworte: | Anti-NMT2, Anti-NMT 2, Anti-Type II N-myristoyltransferase, Anti-Peptide N-myristoyltransferase 2, Anti-Glycylpeptide... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 178,00 €