Zu "99519-84-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Carboxyamidotriazole
Artikelnummer: TGM-T14872-10mg
Description: Carboxyamidotriazole is a cytostatic inhibitor of non-voltage-operated calcium channels and calcium channel-mediated signaling pathways. It shows anti-inflammatory, anti-tumor, and antiangiogenic effects. Target: Calcium Channel. Smiles: NC(=O)c1nnn(Cc2cc(Cl)c(C(=O)c3ccc(Cl)cc3)c(Cl)c2)c1N. References:...
| Schlagworte: | L-651582, CAI |
| Anwendung: | Non-selective calcium channel blocker |
| CAS | 99519-84-3 |
| MW: | 424.67 D |
ab 259,00 €
Carboxyamidotriazole
Artikelnummer: Cay28732-10
Carboxyamidotriazole is an orally bioavailable, non-selective calcium channel blocker. It blocks L- and T-type calcium channels in GH3 rat pituitary cancer cells (IC50s = 0.5 and 1.5 µg/ml, respectively). It also inhibits calcium influx stimulated by the acetylcholine receptor agonist carbachol (carbamoylcholine,...
| Schlagworte: | CAI, L-651,582, NSC 609974, 5-amino-1-[[3,5-dichloro-4-(4-chlorobenzoyl)phenyl]methyl]-1H-1,2,3-triazole-4-carboxamide |
| Anwendung: | Non-selective calcium channel blocker |
| CAS | 99519-84-3 |
| MW: | 424.7 D |
ab 142,00 €
