Zu "960374-59-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ONX 0914
Artikelnummer: AG-CR1-3674-M005
Synthetic. Chemical. CAS: 960374-59-8. Formula: C31H40N4O7. MW: 580.7. Synthetic. Potent and selective 20S immunoproteasome inhibitor. Targets the beta5i subunit [LMP7] of the 20S immunoproteasome (IC50=73nM) and with minimal crossreactivity to the chymotrypsin-like beta5 subunit of the constitutive 20S proteasome...
| Schlagworte: | N-[2-(4-Morpholinyl)acetyl]-L-alanyl-O-methyl-N-[(1S)-2-[(2R)-2-methyl-2-oxiranyl]-2-oxo-1-(phenylmethyl)ethyl]-L-tyrosina... |
| Anwendung: | Potent, selective 20S immunoproteasome (PSMB8) inhibitor |
| CAS | 960374-59-8 |
| MW: | 580,7 D |
ab 61,00 €
ONX-0914
Artikelnummer: TGM-T6029-10mg
Description: ONX-0914 (PR-957) is a potent and highly specific immunoproteasome inhibitor with minimal cross-reactivity to the constitutive proteasome. Target: HIV Protease, Antibacterial, Proteasome. Smiles: COc1ccc(C[C@H](NC(=O)[C@H](C)NC(=O)CN2CCOCC2)C(=O)N[C@@H](Cc2ccccc2)C(=O)[C@@]2(C)CO2)cc1. References:...
| Schlagworte: | PR-957, ONX0914, ONX 0914 |
| Anwendung: | Potent, selective 20S immunoproteasome (PSMB8) inhibitor |
| CAS | 960374-59-8 |
| MW: | 580.67 D |
ab 48,00 €
ONX 0914
Artikelnummer: Cay16271-25
The immunoproteasome is a specialized, inducible proteasome that generates peptides presented on major histocompatibility complex (MHC) class I molecules to cytotoxic T cells. Stimulation of cells with inflammatory cytokines such as IFN-gamma leads to the replacement of constitutive catalytic proteasome beta...
| Schlagworte: | PR-957,... |
| Anwendung: | Immunoproteasome inhibitor |
| CAS | 960374-59-8 |
| MW: | 580.7 D |
ab 85,00 €
