Zu "95737-68-1" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Pyriproxyfen
Artikelnummer: TGM-T16696-10g
Description: Pyriproxyfen (S-31183) is an insecticide that acts as a biomimetic of juvenile hormone. Target: Others. Smiles: O(C1=CC=C(OCC(OC2=CC=CC=N2)C)C=C1)C3=CC=CC=C3
| Schlagworte: | S-31183 |
| Anwendung: | Antiparasitic |
| CAS | 95737-68-1 |
| MW: | 321.37 D |
ab 30,00 €
Pyriproxyfen
Artikelnummer: LKT-P9767.5
Grey to white crystalline powder. A larvicidal agent that mimics juvenile hormone. Shown to prevent maturation of many species of insect.
| Anwendung: | Larvicidal agent |
| CAS | 95737-68-1 |
| MW: | 321,37 D |
ab 153,00 €
Pyriproxyfen
Artikelnummer: Cay21872-100
Pyriproxyfen is a pyridine insecticide that mimics juvenile growth hormone, which prevents larvae from developing into reproduction-capable adults. The LD50 of pyriproxyfen in rats is >5,000 mg/kg, >1,300 mg/cubic meter/4 hours, and >2,000 mg/kg through oral, inhalation, or percutaneous dosing, respectively. It is...
| Schlagworte: | OMS-3019, S-31183, 2-[1-methyl-2-(4-phenoxyphenoxy)ethoxy]-pyridine |
| Anwendung: | Antiparasitic, insecticide, juvenile hormone mimic |
| CAS | 95737-68-1 |
| MW: | 321.4 D |
52,00 €
Pyriproxyfen
Artikelnummer: LKT-P9767.1
Grey to white crystalline powder. A larvicidal agent that mimics juvenile hormone. Shown to prevent maturation of many species of insect.
| Schlagworte: | Sumilarv, 2-[1-Methyl-2-(4-phenoxyphenoxy)ethoxy]pyridine |
| Anwendung: | Larvicidal agent |
| CAS | 95737-68-1 |
| MW: | 321.37 D |
72,00 €
