Zu "957230-65-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Afegostat D-Tartrate
Artikelnummer: TGM-T19182-10mg
Description: Afegostat D-Tartrate is a pharmacological chaperone that binds specifically and reversibly with high affinity to acid-beta-glucosidase (GCase) in the endoplasmic reticulum. Target: Others. Smiles: [C@H]([C@@H](C(O)=O)O)(C(O)=O)O.C(O)[C@@H]1[C@@H](O)[C@H](O)CNC1. References: Richter F, et al. A GCase...
| Schlagworte: | D-Isofagomine D-Tartrate, Isofagomine D-Tartrate |
| Anwendung: | Competitive glucosylceramidase (GBA) inhibitor |
| CAS | 957230-65-8 |
| MW: | 297.26 D |
ab 263,00 €
Isofagomine (D-tartrate)
Artikelnummer: Cay16137-5
Isofagomine (D-tartrate) is a competitive inhibitor of human lysosomal beta-glucosidase (Ki = 0.016-0.025 µM, IC50 = 0.06 µM). By interacting with the catalytic pocket of beta-glucosidase it acts as a chemical chaperone that increases the amount of beta-glucosidase by stabilizing and/or promoting the folding of the...
| Schlagworte: | 5R-(hydroxymethyl)-3R,4R-piperidinediol, mono 2S,3S-dihydroxybutanedioate |
| Anwendung: | Competitive glucosylceramidase (GBA) inhibitor |
| CAS | 957230-65-8 |
| MW: | 297.3 D |
ab 109,00 €
