Zu "950762-95-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PCI-34051
Artikelnummer: TGM-T6325-100mg
Description: PCI-34051 is an effective and selective HDAC8 inhibitor (IC50: 10 nM). Target: HDAC, Apoptosis. Smiles: COc1ccc(Cn2ccc3ccc(cc23)C(=O)NO)cc1. References: Balasubramanian S, et al. Leukemia. 2008, 22(5), 1026-1034.
| Schlagworte: | PCI 34051 |
| Anwendung: | HDAC inhibitor |
| CAS | 950762-95-5 |
| MW: | 296.32 D |
ab 54,00 €
PCI 34051
Artikelnummer: Cay10444-10
PCI 34051 is a potent histone deacetylase (HDAC) 8 inhibitor (IC50 = 0.01 µM) with >200-fold selectivity over HDAC isoforms 1, 2, 3, 6, and 10 (IC50s = 4, >50, >50, 2.9, and 13 µM, respectively). PCI 34051 induces caspase-dependent apoptosis in cell lines derived from T-cell lymphomas or leukemias (GI50s = 2.4 - 4...
| Schlagworte: | N-hydroxy-1-[(4-methoxyphenyl)methyl]-1H-indole-6-carboxamide |
| Anwendung: | HDAC inhibitor |
| CAS | 950762-95-5 |
| MW: | 296.3 D |
ab 104,00 €
