Zu "937782-05-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Difamilast
Artikelnummer: TGM-T27172-100mg
Description: Difamilast is a selective inhibitor of phosphodiesterase-4 (PDE4) with particularly efficient inhibition of subtype B (IC50=11.2 nM). Target: PDE. Smiles: CCOc1ccccc1C(=O)NCc1coc(n1)-c1ccc(OC(F)F)c(OC(C)C)c1. References: Ahluwalia J, et, al. Phosphodiesterase 4 Inhibitor Therapies for Atopic Dermatitis:...
| Anwendung: | Targets cAMP-specific phosphodiesterase 4 [EC:3.1.4.53] (PDE4) |
| CAS | 937782-05-3 |
| MW: | 446.44 D |
ab 129,00 €
Difamilast
Artikelnummer: Cay39664-1
Difamilast is an inhibitor of phosphodiesterase 4 (PDE4). It is selective for the PDE4 isoforms PDE4A, PDE4B, PDE4C, and PDE4D (IC50s = 0.0832, 0.0112, 0.2493 and 0.0738 µM, respectively) over PDE5A and PDE10A (IC50s = 4.793 and 1.4346 µM, respectively) and eight other PDEs (IC50s = >10 µM for all). Difamilast...
| Schlagworte: | OPA 15406, N-[[2-[4-(difluoromethoxy)-3-(1-methylethoxy)phenyl]-4-oxazolyl]methyl]-2-ethoxy-benzamide |
| Anwendung: | PDE4 inhibitor |
| CAS | 937782-05-3 |
| MW: | 446.4 D |
ab 101,00 €
