Zu "936563-96-1" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ibrutinib
Artikelnummer: TGM-T1835-100mg
Description: Ibrutinib (PCI-32765) is an irreversible inhibitor of BTK (IC50: 0.5 nM) that selectively blocks B cell activation. Target: Tyrosine Kinases, Src, BTK, Ligands for Target Protein for PROTAC. Smiles: NC1=C2C(N(N=C2C3=CC=C(OC4=CC=CC=C4)C=C3)[C@H]5CN(C(C=C)=O)CCC5)=NC=N1. References: Honigberg LA, et...
| Schlagworte: | PCI-32765 |
| Anwendung: | Targets Bruton agammaglobulinemia tyrosine kinase [EC:2.7.10.2] (BTK) |
| CAS | 936563-96-1 |
| MW: | 440.5 D |
ab 37,00 €
Ibrutinib
Artikelnummer: Cay16274-1
Bruton's tyrosine kinase (BTK) is a member of the BTK/Tec family of protein tyrosine kinases involved in signal transduction pathways regulating proliferation, survival, migration, and tissue homing of B-cells. Ibrutinib is an irreversible inhibitor of BTK (IC50 = 0.5 nM) that selectively blocks B cell activation,...
| Schlagworte: | Imbruvica, PCI 32765, 1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl]-1-piperidinyl]-2-propen-1-one |
| Anwendung: | BTK inhibitor |
| CAS | 936563-96-1 |
| MW: | 440.5 D |
ab 52,00 €
PCI-32765
Artikelnummer: LKT-P0932.1
PCI-32765 is an irreversible inhibitor of Bruton's tyrosine kinase (BTK), an enzyme that plays a significant role in B-cell receptor signaling and B-cell malignancies and autoimmune diseases such as x-linked agammaglobulinemia, chronic lymphocytic leukemia, and non-Hodgkin's lymphoma. PCI-32765's inhibition of BTK...
| Schlagworte: | Ibrutinib |
| Anwendung: | Bruton's tyrosine kinase inhibitor |
| CAS | 936563-96-1 |
| MW: | 440.5 D |
ab 104,00 €
Ibrutinib
Artikelnummer: AG-CR1-3620-M005
White solid. Soluble in DMSO. Slightly soluble in ethanol (1mg/ml). Insoluble in water. Potent and highly selective Bruton's tyrosine kinase (BTK) inhibitor. Orally bioavailable and irreversible inhibitor of BTK (IC50 = 0.5 nM) with antineoplastic activity, Binds to and irreversibly inhibits BTK activity, preventing...
| Schlagworte: | PCI-32765 |
| Anwendung: | BTK inhibitor |
| CAS | 936563-96-1 |
| MW: | 440,5 D |
ab 88,00 €
