Zu "934369-14-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TY-52156
Artikelnummer: TGM-T17183-5mg
Description: TY-52156 is an effective and selective S1P3 receptor antagonist (Ki: 110 nM). Target: LPL Receptor, S1P Receptor. Smiles: CC(C)(C)C(=O)C(\NNc1ccc(Cl)cc1)=N\c1ccc(Cl)cc1
| Anwendung: | S1PR3 antagonist |
| CAS | 934369-14-9 |
| MW: | 364.27 D |
ab 34,00 €
TY 52156
Artikelnummer: Cay19119-5
TY 52156 is a selective sphingosine-1-phosphate receptor 3 (SIP3) antagonist (Ki = 110 nM). It preferentially inhibits the S1P-induced increase in intracellular calcium in Chinese hamster ovary cells expressing S1P3 over cell expressing S1P1, S1P2, or S1P4. TY 52156 has been shown to suppress FTY720-induced S1P3...
| Schlagworte: | N-(4-chlorophenyl)-3,3-dimethyl-2-oxobutanimidic acid, 2-(4-chlorophenyl)hydrazide |
| Anwendung: | S1PR3 antagonist |
| CAS | 934369-14-9 |
| MW: | 364.3 D |
ab 44,00 €
