Zu "92614-59-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Glutathione ethyl ester
Artikelnummer: TGM-T78616-2mg
Description: Glutathione ethyl ester, a cell-permeable GSH donor, enhances the in vitro production of embryos by bolstering antioxidative defense, thereby ensuring an effective GSH supply to the oocyte [1]. Target: Reactive Oxygen Species. Smiles: CCOC(=O)CNC(=O)[C@H](CS)NC(=O)CC[C@H](N)C(O)=O
| Anwendung: | Cell permeable glutathione transferase co-substrate |
| CAS | 92614-59-0 |
| MW: | 335.38 D |
57,00 €
Glutathione ethyl ester
Artikelnummer: Cay14953-100
Glutathione (GSH) ethyl ester is a cell-permeable derivative of GSH (Cay-10007461), a nucleophilic co-substrate to glutathione transferases. It increases mitochondrial GSH levels in C38 and IB3-1 epithelial lung cystic fibrosis cells when used at a concentration of 10 mM. GSH ethyl ester (10 mM) decreases reactive...
| Schlagworte: | GSH ethyl ester, L-gamma-glutamyl-L-cysteinyl-glycine, 3-ethyl ester |
| Anwendung: | Cell permeable glutathione transferase co-substrate |
| CAS | 92614-59-0 |
| MW: | 335.4 D |
ab 68,00 €
GSH-Oet
Artikelnummer: CDX-G0006-M500
Solid. Soluble in DMSO. GSH-OEt is cellpermeable and has been used to protect cells against radiation damage, oxidants and various toxic compounds including heavy metals. GSH-OEt is a protective agent against cellular damage, such as cataracts and mitochondrial degeneration. It undergoes hydrolysis by intracellular...
| Schlagworte: | Glutathione reduced ethyl ester |
| Anwendung: | Cell permeable glutathione |
| CAS | 92614-59-0 |
| MW: | 335,38 D |
ab 85,00 €
