Zu "919783-22-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AZD 1656
Artikelnummer: Cay41839-1
AZD 1656 is an activator of hexokinase-4 (HK4). It activates HK4 and induces glucose phosphorylation in a cell-free assay (EC50 = 61 nM). AZD 1656 (0.3 mg/kg) decreases blood glucose levels in an oral glucose tolerance test (OGTT) in rats. It reduces blood glucose levels and increases plasma insulin levels in mice...
| Schlagworte: | 3-[[5-(1-azetidinylcarbonyl)-2-pyrazinyl]oxy]-5-[(1S)-2-methoxy-1-methylethoxy]-N-(5-methyl-2-pyrazinyl)-benzamide |
| Anwendung: | Hexokinase-4 (HK4, Glucokinase) activator |
| CAS | 919783-22-5 |
| MW: | 478.5 D |
ab 75,00 €
AZD-1656
Artikelnummer: TGM-T26712-10mg
Description: AZD-1656 is a glucokinase activator (GKA) that can cause dose-limiting hypoglycemia in normal animals used in embryofetal development studies and type 2 diabetes. Target: Glucokinase. Smiles: COC[C@H](C)Oc1cc(Oc2cnc(cn2)C(=O)N2CCC2)cc(c1)C(=O)Nc1cnc(C)cn1. References: Krentz AJ, et al. Effect of...
| Schlagworte: | AZD 1656 |
| CAS | 919783-22-5 |
| MW: | 478.5 D |
ab 83,00 €
