Zu "91978-69-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
p-Cresyl sulfate potassium
Artikelnummer: TGM-T19498-100mg
Description: p-Cresyl sulfate potassium (p-Tolyl sulfate potassium salt) is a prototype protein-bound uremic toxin derived from the metabolites of tyrosine and phenylalanine through liver. Target: Endogenous Metabolite. Smiles: [K+].Cc1ccc(OS([O-])(=O)=O)cc1. References: Gryp T, et al. p-Cresyl Sulfate. Toxins...
| Schlagworte: | p-Tolyl sulfate potassium salt, p-Methylphenyl potassium sulfate, p-Cresol sulfate potassium, Potassium p-tolyl sulfate |
| CAS | 91978-69-7 |
| MW: | 226.29 D |
ab 33,00 €
p-Cresol sulfate (potassium salt)
Artikelnummer: Cay29504-1
p-Cresol sulfate is a sulfate conjugate of the uremic toxin p-cresol, which is formed by bacterial fermentation of proteins in the large intestine. p-Cresol sulfate increases migration and proliferation of isolated rat aortic vascular smooth muscle cells (VSMCs) when used at a concentration of 500 µM. It also...
| Schlagworte: | para-Cresol sulfate, 4-Cresyl sulfate, sulfuric acid, mono(4-methylphenyl) ester, monopotassium salt |
| Anwendung: | Advanced stage chronic kidney disease marker |
| CAS | 91978-69-7 |
| MW: | 226.3 D |
ab 43,00 €
![p-Cresol Sulfate-[ 2H7] Potassium Salt](/custom/plugins/NetiThemeBiomol/Resources/Themes/Frontend/Biomol/frontend/_public/src/img/no-picture.jpg "p-Cresol Sulfate-[ 2H7] Potassium Salt")
p-Cresol Sulfate-[ 2H7] Potassium Salt
Artikelnummer: ISO-12303.10
Isotope Incorporation: >98%
| Schlagworte: | Deuterium-labelled, p-Tolyl Sulfate-[ 2H7] Potassium Salt, CAS of labelled compound: 6830-21-3 |
| Anwendung: | LC/MS internal standard |
| CAS | 91978-69-7 |
265,00 €
