Zu "917389-32-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Letermovir
Artikelnummer: TGM-T5396-100mg
Description: Letermovir (AIC246) (AIC246) is a novel anti-CMV compound (EC50: about 5 nM in fibroblast cells). It targets the pUL56 subunit of the viral terminase complex. Target: HCV Protease, Others. Smiles: COc1cccc(c1)N1CCN(CC1)C1=Nc2c(F)cccc2[C@H](CC(O)=O)N1c1cc(ccc1OC)C(F)(F)F. References: Lischka P, et al....
| Schlagworte: | MK-8828, AIC246 |
| CAS | 917389-32-3 |
| MW: | 572.55 D |
ab 81,00 €
Letermovir
Artikelnummer: Cay17556-1
Letermovir is a small molecule inhibitor of human cytomegalovirus viral replication (EC50 = ~5 nM with a selectivity index >15,000) that targets viral DNA cleavage and packaging. It functions to prevent viral DNA concatemers from forming the proper unit length and interferes with virion maturation.Formal Name:...
| Schlagworte: | AIC246,... |
| Anwendung: | Human cytomegalovirus viral replication inhibitor |
| CAS | 917389-32-3 |
| MW: | 572.6 D |
ab 100,00 €
