Zu "913827-99-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
CS 2100
Artikelnummer: Cay14396-10
CS 2100 is a sphingosine-1-phosphate receptor 1 (S1P1) agonist. It selectively induces GTPgammaS binding in CHO-K1 cells expressing human or rat S1P1 (EC50s = 4 and 1.5 nM, respectively) over those expressing human or rat S1P3 (EC50s = >20 and 7.4 µM, respectively). CS 2100 (0.1 and 1 mg/kg) transiently reduces...
| Schlagworte: | 1-[[4-ethyl-5-[5-(4-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]-2-thienyl]methyl]-3-azetidinecarboxylic acid |
| Anwendung: | S1P1 agonist |
| CAS | 913827-99-3 |
| MW: | 461.5 D |
ab 136,00 €
CS 2100
Artikelnummer: TGM-T22697-100mg
Description: CS 2100 (1-[[4-Ethyl-5-[5-(4-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]-2-thienyl]methyl]-3-azetidinecarboxylic acid) is an S1P1 agonist. Target: S1P Receptor. Smiles: C(C)C1=C(SC(CN2CC(C(O)=O)C2)=C1)C=3N=C(ON3)C4=CC=C(OC5=CC=CC=C5)C=C4. References: Nakamura T, Asano M, Sekiguchi Y, et al.Synthesis and...
| Schlagworte: | 1-[[4-Ethyl-5-[5-(4-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]-2-thienyl]methyl]-3-azetidinecarboxylic acid |
| CAS | 913827-99-3 |
| MW: | 461.53 D |
ab 41,00 €
