Zu "911378-38-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
RBI-257 Maleate
Artikelnummer: TGM-T28505-1mg
Description: RBI-257 Maleate is a highly potent selective ligand of dopamine D4 receptor. Target: Others. Smiles: C(=C\C(O)=O)\C(O)=O.N(C)(C1=C(OC(C)C)C=CC=N1)C2CCN(CC3=CC=C(I)C=C3)CC2. References: Kula NS, Baldessarini RJ, Kebabian JW, Bakthavachalam V, Xu L. RBI-257: a highly potent dopamine D4 receptor-selective...
| Schlagworte: | RBI257 Maleate, RBI 257 Maleate, p-Iodo-U-101958 Maleate, p-Iodo U-101958 Maleate |
| Anwendung: | D4 receptor antagonist |
| CAS | 911378-38-6 |
| MW: | 581.44 D |
ab 166,00 €
RBI 257 (maleate)
Artikelnummer: Cay17223-1
RBI 257 is a potent dopamine D4 receptor antagonist (Ki = 0.3 nM) that is selective over D2L, D3, D2-like, and D1 receptors by 1,721-, 439-, 1,336-, and 8,576-fold, respectively.Formal Name: N-[1-[(4-iodophenyl)methyl]-4-piperidinyl]-N-methyl-3-(1-methylethoxy)-2-pyridinamine (2Z)-2-butenedioate. CAS Number:...
| Schlagworte: | N-[1-[(4-iodophenyl)methyl]-4-piperidinyl]-N-methyl-3-(1-methylethoxy)-2-pyridinamine (2Z)-2-butenedioate |
| Anwendung: | D4 receptor antagonist |
| CAS | 911378-38-6 |
| MW: | 581.4 D |
ab 92,00 €
