Zu "910808-11-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Netupitant metabolite Netupitant N-oxide
Artikelnummer: TGM-T12213-10mg
Description: Netupitant N-oxide is a highly selective antagonist of NK1 receptor, is Netupitant metabolite. Target: Others. Smiles: O=C(N(C1=CN=C(C=C1C=2C=CC=CC2C)N3CCN(=O)(C)CC3)C)C(C=4C=C(C=C(C4)C(F)(F)F)C(F)(F)F)(C)C
| Schlagworte: | Netupitant N-oxide |
| Anwendung: | Netupitant metabolite |
| CAS | 910808-11-6 |
| MW: | 594.59 D |
ab 157,00 €
Netupitant N-oxide
Artikelnummer: Cay34005-1
Netupitant N-oxide is a metabolite of the neurokinin-1 (NK1) receptor antagonist netupitant (Cay-23809). Netupitant N-oxide is formed from netupitant by the cytochrome P450 (CYP) isoform CYP3A4.Formal Name:...
| Schlagworte: | N,alpha,alpha-trimethyl-N-[6-(4-methyl-4-oxido-1-piperazinyl)-4-(2-methylphenyl)-3-pyridinyl]-3,5-bis(trifluoromethyl)-ben... |
| Anwendung: | Netupitant metabolite |
| CAS | 910808-11-6 |
| MW: | 594.6 D |
ab 86,00 €
