Zu "910376-39-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PF-03550096
Artikelnummer: TGM-T84412-10mg
Description: PF-03550096, an orally active synthetic cannabinoid (CB), selectively binds to peripheral CB2 receptors with a Ki value of 7.9 nM, demonstrating analgesic activity [1]. Target: Others. Smiles: C(N[C@@H]([C@](C)(C)C)C(N)=O)(=O)N1C=2C(N(CCC(C)(C)O)C1=O)=CC=CC2
| Anwendung: | Synthetic cannabinoid (CB2 receptor) |
| CAS | 910376-39-5 |
| MW: | 376.45 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
PF-03550096
Artikelnummer: Cay15620-1
PF-03550096 is a synthetic cannabinoid (CB) that selectively targets the peripheral CB2 receptor over the central CB1 receptor (Kis = 7.9 and 1,500 nM for human isoforms, respectively). It shows similar selectivity for inhibiting forskolin-stimulated cAMP production in CHO cells expressing human CB1 and CB2...
| Schlagworte: | N-[(1S)-1-(aminocarbonyl)-2,2-dimethylpropyl]-2,3-dihydro-3-(3-hydroxy-3-methylbutyl)-2-oxo-1H-benzimidazole-1-carboxamide |
| Anwendung: | Analytical reference standard, synthetic cannabinoid (CB2 receptor) |
| CAS | 910376-39-5 |
| MW: | 376.5 D |
ab 111,00 €
