Zu "906673-24-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Crisaborole
Artikelnummer: TGM-T4285-100mg
Description: Crisaborole (AN-2728) is a phosphodiesterase 4 inhibitor. Target: PDE. Smiles: OB1OCc2cc(Oc3ccc(cc3)C#N)ccc12. References: Akama T, et al. Discovery and structure-activity study of a novel benzoxaborole anti-inflammatory agent (AN2728) for the potential topical treatment of psoriasis and atopic...
| Schlagworte: | PF-06930164, AN-2728 |
| Anwendung: | Targets cAMP-specific phosphodiesterase 4 [EC:3.1.4.53] (PDE4) |
| CAS | 906673-24-3 |
| MW: | 251.05 D |
ab 38,00 €
AN2728
Artikelnummer: Cay21455-100
AN2728 is a boron-based, topical anti-inflammatory agent that inhibits phosphodiesterase 4 (PDE4, IC50 = 0.11 µM). It is less potent against PDE1A, PDE3A, and PDE7A (IC50s = 6.12, 6.41, and 0.73 µM, respectively). AN2728 suppresses the release of the proinflammatory cytokines TNF-alpha, IL-2, INF-gamma, IL-5, and...
| Schlagworte: | Crisaborole, 4-[(1,3-dihydro-1-hydroxy-2,1-benzoxaborol-5-yl)oxy]-benzonitrile |
| Anwendung: | PDE4 inhibitor |
| CAS | 906673-24-3 |
| MW: | 251.1 D |
ab 84,00 €
