Zu "906-33-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Neochlorogenic acid
Artikelnummer: TGM-T6S1538-1mL
Description: Neochlorogenic acid (trans-5-O-Caffeoylquinic acid) is an antioxidant compound used in the treatment of oxidative stress and related afflictions. Target: Antibacterial, COX, Interleukin, TNF, NF-kappaB. Smiles: O[C@@H]1C[C@@](O)(C[C@@H](OC(=O)\C=C\c2ccc(O)c(O)c2)[C@H]1O)C(O)=O. References:...
| Schlagworte: | trans-5-O-Caffeoylquinic acid, 5-O-Caffeoylquinic acid, Neochlorogenate |
| CAS | 906-33-2 |
| MW: | 354.31 D |
ab 78,00 €
5-O-Caffeoylquinic Acid
Artikelnummer: Cay25054-10
5-O-Caffeoylquinic acid (5-CQA) is a phenolic compound that has been found in M. domestica and has diverse biological activities, including antioxidant, anti-inflammatory, and antidiabetic properties. 5-CQA scavenges 2,2-diphenyl-1-picrylhydrazyl (DPPH, Cay-14805, EC50 = 0.184 mg/ml) and...
| Schlagworte: | trans-5-O-Caffeoylquinic Acid, 5-O-Caffeoylquinic Acid, Neochlorogenic Acid,... |
| Anwendung: | Bioactive phenolic compound |
| CAS | 906-33-2 |
| MW: | 354.3 D |
ab 109,00 €
