Zu "905973-89-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CGK733
Artikelnummer: TGM-T1821-100mg
Description: CGK733 (CGK 733) is a potent and selective inhibitor of ATM/ATR. Target: ATM/ATR. Smiles: [O-][N+](=O)c1cc(NC(=S)NC(NC(=O)C(c2ccccc2)c2ccccc2)C(Cl)(Cl)Cl)ccc1F. References: Won J, et al. Nat Chem Biol, 2006, 2(7), 369-374.
| Schlagworte: | CGK 733 |
| Anwendung: | ATM inhibitor |
| CAS | 905973-89-9 |
| MW: | 555.84 D |
ab 31,00 €
CGK733
Artikelnummer: Cay16242-10
CGK733 is an anticancer compound that was originally identified as an inhibitor of ataxia-telangiectasia mutated kinase (ATM) and ataxia-telangiectasia and Rad3-related kinase (ATR) in a study that has since been retracted. It inhibits irradiation-induced activation of ATM in a reporter assay using HEK293 cells when...
| Schlagworte: | ATM/ATR Kinase Inhibitor,... |
| Anwendung: | ATM inhibitor |
| CAS | 905973-89-9 |
| MW: | 555.8 D |
ab 77,00 €
CGK 733
Artikelnummer: LKT-C2540.1
ATM and ATR inhibitor.
| Schlagworte: | CGK733, ATM/ATR Kinase Inhibitor |
| Anwendung: | ATM and ATR inhibitor |
| CAS | 905973-89-9 |
| MW: | 555.83 D |
ab 99,00 €
