Zu "896466-04-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AT9283
Artikelnummer: TGM-T3068-100mg
Description: AT9283 (J-504568) is an effective multi-targeted inhibitor of JAK2(IC50=1.2 nM) and JAK3(IC50=1.1 nM), Aurora A, Aurora B and Abl(T315I). Target: JAK, FLT, Autophagy, Aurora Kinase, Apoptosis, Bcr-Abl. Smiles: O=C(NC1CC1)Nc1c[nH]nc1-c1nc2cc(CN3CCOCC3)ccc2[nH]1. References: Howard S, et al. J Med...
| Schlagworte: | J-504568 |
| Anwendung: | Broad spectrum kinase inhibitor |
| CAS | 896466-04-9 |
| MW: | 381.43 D |
ab 39,00 €
AT-9283
Artikelnummer: Cay11496-5
AT-9283 is a broad spectrum kinase inhibitor that potently inhibits Aurora A, Aurora B, JAK2, JAK3, and c-ABL (IC50s = 3, 3, 1.2, 1.1, and 4 nM, respectively). It also potently (IC50 = receptor tyrosine kinases. As Aurora kinases have roles in mitosis, inhibitors of these kinases, including AT-9283, have potential...
| Schlagworte: | N-cyclopropyl-N'-[3-[6-(4-morpholinylmethyl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]-urea |
| Anwendung: | Broad spectrum kinase inhibitor |
| CAS | 896466-04-9 |
| MW: | 381.4 D |
ab 113,00 €
AT9283
Artikelnummer: SYN-1011-M001
Soluble in DMSO or ethanol. Aurora kinases play a key role in the regulation of mitosis and in recent years have become attractive targets for the treatment of cancer. AT9283 is a powerful inhibitor of Aurora A and B kinases as well as several other important kinases including JAK2 and Abl (T315I). AT9283 has also...
| Schlagworte: | AT-9283 |
| Anwendung: | Aurora inhibitor |
| CAS | 896466-04-9 |
| MW: | 381,4 D |
ab 106,00 €
