Zu "895519-90-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Flumatinib
Artikelnummer: TGM-T4320-100mg
Description: Flumatinib (HHGV678) is an orally bioavailable tyrosine kinase inhibitor with potential antineoplastic activity. Target: Bcr-Abl, PDGFR, c-Kit. Smiles: CN1CCN(Cc2ccc(cc2C(F)(F)F)C(=O)Nc2cnc(C)c(Nc3nccc(n3)-c3cccnc3)c2)CC1. References: Luo H, et al. HH-GV-678, a novel selective inhibitor of Bcr-Abl,...
| Schlagworte: | HHGV678 |
| Anwendung: | Bcr-Abl inhibitor |
| CAS | 895519-90-1 |
| MW: | 562.59 D |
ab 31,00 €
Flumatinib
Artikelnummer: Cay36226-10
Flumatinib is an inhibitor of the non-receptor tyrosine kinase Bcr-Abl (IC50 = 1.2 nM). It is selective for Bcr-Abl over VEGFR2, c-Src, EGFR, and HER2 at 1 µM but does inhibit PDGFRbeta and c-Kit (IC50s = 307.6 and 665.5 nM, respectively). Flumatinib inhibits the proliferation of K562 chronic myelogenous leukemia...
| Schlagworte: | HH-GV-678,... |
| Anwendung: | Bcr-Abl inhibitor |
| CAS | 895519-90-1 |
| MW: | 562.6 D |
ab 48,00 €
