Zu "878978-76-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ML-098
Artikelnummer: TGM-T4619-100mg
Description: ML-098 (CID-7345532) is an activator of the GTP-binding protein Rab7 with an EC50 value of 77.6 nM. Target: Ras. Smiles: Cc1ccc(C)c(OCCn2cc(C(O)=O)c3ccccc23)c1. References: Surviladze, Z., Ursu, O., Miscisocia, F., et al. UNMCMD Probe Report: Three small molecule pan activator families of Ras-related...
| Schlagworte: | CID-7345532 |
| Anwendung: | Rab7 activator |
| CAS | 878978-76-8 |
| MW: | 309.36 D |
ab 34,00 €
ML-098
Artikelnummer: Cay15175-1
The Ras family of GTPases, including the Arf, Rho, Ras, and Rab GTPase subfamilies, regulates various cellular processes ranging from membrane trafficking to the control of cell proliferation. They regulate cell physiology by switching between active and inactive conformational states by binding either GTP or GDP....
| Schlagworte: | CID-7345532, 1-[2-(2,5-dimethylphenoxy)ethyl]-1H-indole-3-carboxylic acid |
| Anwendung: | Rab7 activator |
| CAS | 878978-76-8 |
| MW: | 309.4 D |
ab 61,00 €
