Zu "874590-32-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
M1001
Artikelnummer: TGM-T7802-100mg
Description: M1001 is a HIF-2alpha agonist. Target: HIF/HIF Prolyl-Hydroxylase, HIF. Smiles: O=S1(=O)N=C(Nc2ccccc2N2CCCC2)c2ccccc12. References: Bidirectional Modulation of HIF-2 Activity through Chemical Ligands[C]// 0.
| Anwendung: | HIF-2alpha (EPAS1) modulator |
| CAS | 874590-32-6 |
| MW: | 327.4 D |
ab 55,00 €
M1001
Artikelnummer: Cay37393-1
M1001 is a modulator of hypoxia-inducible factor-2alpha (HIF-2alpha). It stabilizes the aryl hydrocarbon receptor nuclear translocator (ARNT) and HIF-2alpha protein-protein interaction and promotes the gene expression of HIF-2alpha targets VEGF-A, CCND1, SLC2A1, and NDRG1, in 786-O cells when used at a concentration...
| Schlagworte: | N-[2-(1-pyrrolidinyl)phenyl]-1,2-benzisothiazol-3-amine, 1,1-dioxide |
| Anwendung: | HIF-2alpha (EPAS1) modulator |
| CAS | 874590-32-6 |
| MW: | 327.4 D |
ab 49,00 €
