Zu "870964-67-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Evocalcet
Artikelnummer: TGM-T15261-100mg
Description: Evocalcet (KHK7580) has an activating effect on the calcium-sensing receptor (CaSR). Target: CaSR. Smiles: C[C@@H](N[C@H]1CCN(C1)c1ccc(CC(O)=O)cc1)c1cccc2ccccc12. References: Tanimura, Shinji, et al. Pharmaceutical composition containing aryl alkyl amine compound. WO 2017061621 A1.
| Schlagworte: | KHK7580 |
| Anwendung: | Targets calcium-sensing receptor (CASR) |
| CAS | 870964-67-3 |
| MW: | 374.48 D |
ab 31,00 €
Evocalcet
Artikelnummer: Cay33346-1
Evocalcet is an agonist of the calcium-sensing receptor (CaSR). It induces intracellular calcium release in HEK293 cells expressing human CaSR (EC50 = 92.7 nM). Evocalcet reduces serum levels of parathyroid hormone (PTH) and calcium when administered at doses of 0.3 and 0.1 mg/kg, respectively, in non-nephrectomized...
| Schlagworte: | KHK7580, MT-4580, 4-[(3S)-3-[[(1R)-1-(1-naphthalenyl)ethyl]amino]-1-pyrrolidinyl]-benzeneacetic acid |
| Anwendung: | CaSR agonist |
| CAS | 870964-67-3 |
| MW: | 374.5 D |
ab 85,00 €
