Zu "86933-99-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Vanoxonin
Artikelnummer: TGM-T26315-100mg
Description: Vanoxonin is a new thymidylate synthetase inhibitor. Target: Others. Smiles: C(N[C@H](C(N[C@@H](CCCN(C(C)=O)O)C(O)=O)=O)[C@@H](C)O)(=O)C1=C(O)C(O)=CC=C1. References: Kanai F, Isshiki K, Umezawa Y, Morishima H, Naganawa H, Takita T, Takeuchi T, Umezawa H. Vanoxonin, a new inhibitor of thymidylate...
| Schlagworte: | MG-245-CF2-A, Antibiotic MG 245CF2A |
| CAS | 86933-99-5 |
| MW: | 427.41 D |
ab 2.272,00 €
Vanoxonin
Artikelnummer: Cay32931-1
Vanoxonin is a bacterial metabolite that has been found in S. hirsuta. It forms a complex with vanadium, and the complex inhibits thymidylate synthetase with an IC50 value of 0.7 µg/ml. The vanoxonin-vanadium complex is cytotoxic to L1210 leukemia cells (MIC = 25 µg/ml) and increases survival in Ehrlich murine...
| Schlagworte: | Antibiotic MG 245CF2A, N-(2,3-dihydroxybenzoyl)-L-threonyl-N5-acetyl-N5-hydroxy-L-ornithine |
| Anwendung: | Bioctive bacterial metabolite |
| CAS | 86933-99-5 |
| MW: | 427.4 D |
872,00 €
