Zu "866206-54-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PRX-08066
Artikelnummer: TGM-T16669-100mg
Description: PRX-08066, a selective 5-hydroxytryptamine receptor 2B (5-HT2BR, IC50= 3.4 nM) antagonist, induces selective vasodilation of pulmonary arteries. Target: 5-HT Receptor. Smiles: Fc1ccc(CN2CCC(CC2)Nc2ncnc3sc(Cl)cc23)cc1C#N. References: Porvasnik SL, et al. PRX-08066, a novel 5-hydroxytryptamine receptor 2B...
| Anwendung: | 5-HT2B receptor antagonist |
| CAS | 866206-54-4 |
| MW: | 401.89 D |
ab 54,00 €
PRX-08066
Artikelnummer: Cay31477-1
PRX-08066 is an antagonist of the serotonin (5-HT) receptor subtype 5-HT2B. It binds to 5-HT2B receptors (Ki = 3.4 nM) and inhibits 5-HT-induced MAPK activation and thymidine incorporation in CHO cells expressing human 5-HT2B (IC50s = ~12 and ~3 nM, respectively). PRX-08066 (50 and 100 mg/kg) reduces peak pulmonary...
| Schlagworte: | 5-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1-piperidinyl]methyl]-2-fluoro-benzonitrile |
| Anwendung: | 5-HT2B receptor antagonist |
| CAS | 866206-54-4 |
| MW: | 401.9 D |
ab 98,00 €
