Zu "86443-19-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
1,4-DPCA ethyl ester
Artikelnummer: TGM-T36796-2mg
Description: 1,4-DPCA ethyl ester, the ethyl ester derivative of 1,4-DPCA, acts as an inhibitor of the enzyme factor inhibiting HIF (FIH)[1]. Target: Others. Smiles: CCOC(=O)c1c[nH]c2c3ncccc3ccc2c1=O. References: Biswadip Banerji, et al. The inhibition of factor inhibiting hypoxia-inducible factor (FIH) by...
| Anwendung: | P4HA inhibitor 1,4-DPCA synthetic precursor |
| CAS | 86443-19-8 |
| MW: | 268.27 D |
58,00 €
1,4-DPCA ethyl ester
Artikelnummer: Cay38334-10
1,4-DPCA ethyl ester is a synthetic precursor of the prolyl 4-hydroxylase inhibitor 1,4-DPCA (Cay-71220). 1,4-DPCA ethyl ester is also active against M. tuberculosis (MIC90 = 23.99 µM).Formal Name: 1,4-dihydro-4-oxo-1,10-phenanthroline-3-carboxylic acid, ethyl ester. CAS Number: 86443-19-8. Synonyms:...
| Schlagworte: | 1,4-dihydrophenonthrolin-4-one-3-Carboxylic acid ethyl ester, NSC 371161,... |
| Anwendung: | P4HA inhibitor 1,4-DPCA synthetic precursor |
| CAS | 86443-19-8 |
| MW: | 268.3 D |
ab 62,00 €
