Zu "860352-01-8" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AZD-7762
Artikelnummer: TGM-T6093-100mg
Description: AZD-7762, an effective and specific inhibitor of Chk1(IC50=5 nM), is equally potent against Chk2 and less potent against CAM, Yes, Fyn, Lyn, Hck and Lck. Target: Chk. Smiles: NC(=O)Nc1cc(sc1C(=O)N[C@H]1CCCNC1)-c1cccc(F)c1. References: Zabludoff SD, et al. Mol Cancer Ther, 2008, 7(9), 2955-2966.
| Schlagworte: | AZD7762 |
| Anwendung: | Checkpoint kinase (Chk) inhibitor |
| CAS | 860352-01-8 |
| MW: | 362.42 D |
ab 33,00 €
AZD 7762
Artikelnummer: Cay11491-1
Actively proliferating cells experience blocks at certain checkpoints in the cell cycle when DNA damage is detected. These checkpoints allow for DNA damage repair before further cell cycle progression. Targeting signaling pathways to selectively inhibit repair at these checkpoints in tumor cells is of considerable...
| Schlagworte: | 3-[(aminocarbonyl)amino]-5-(3-fluorophenyl)-N-(3S)-3-piperidinyl-2-thiophenecarboxamide |
| Anwendung: | Checkpoint kinase (Chk) inhibitor |
| CAS | 860352-01-8 |
| MW: | 362.4 D |
ab 35,00 €
AZD-7762 Hydrochloride
Artikelnummer: LKT-A9912.1
CHK1 inhibitor.
| Schlagworte: | AZD-7762 HCl |
| Anwendung: | CHK1 inhibitor |
| CAS | 860352-01-8 |
| MW: | 398.88 D |
ab 142,00 €
AZD-7762
Artikelnummer: LKT-A985130.100
CHK1 inhibitor.
| Schlagworte: | AZD 7762, AZD7762 |
| Anwendung: | Checkpoint kinase (Chk) inhibitor |
| CAS | 860352-01-8 |
| MW: | 362.42 D |
ab 85,00 €
