Zu "852918-02-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TCN 201
Artikelnummer: TGM-T7870-100mg
Description: TCN 201 is a selective antagonist of NMDA receptors containing the NR2A subunit. Target: iGluR, NMDAR. Smiles: Fc1ccc(cc1Cl)S(=O)(=O)NCc1ccc(cc1)C(=O)NNC(=O)c1ccccc1. References: Hansen K B , Ogden K K , Traynelis S . Subunit-selective allosteric inhibition of glycine binding to NMDA receptors[J]....
| Schlagworte: | TCN-201 |
| Anwendung: | NMDA receptor (NR2A) antagonist |
| CAS | 852918-02-6 |
| MW: | 461.89 D |
ab 60,00 €
TCN 201
Artikelnummer: Cay19086-1
TCN 201 is a selective antagonist of NMDA receptors containing the NR2A subunit (pIC50s = 6.8 and 95%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 15 mg/ml, DMF:PBS (pH7.2) (1:40): 0.02 mg/ml, DMSO: 20 mg/ml. lambdamax: 232 nm. SMILES:...
| Schlagworte: | 4-[[[(3-chloro-4-fluorophenyl)sulfonyl]amino]methyl]-benzoic acid 2-benzoylhydrazide |
| Anwendung: | NMDA receptor (NR2A) antagonist |
| CAS | 852918-02-6 |
| MW: | 461.9 D |
ab 55,00 €
