Zu "851398-76-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N6F11
Artikelnummer: TGM-T77745-100mg
Description: N6F11 is a novel, selective and potent inducer of ferroptosis with anticancer and antitumour activity that promotes GPX4 degradation by binding to TRIM25 in cancer cells.N6F11 can be used to study pancreatic cancer. Target: GPX. Smiles: ClCC1=NC2=C(SC(=C2)C2=CC=C(Cl)C=C2)C(=O)N1. References: Li J, et...
| Anwendung: | Ferroptosis inducer, GPX4 degradation inducer |
| CAS | 851398-76-0 |
| MW: | 311.19 D |
ab 194,00 €
N6F11
Artikelnummer: Cay39919-25
N6F11 is an inducer of ferroptosis. It increases the thermal stability of the ubiquitin ligase TRIM25 in a cellular thermal shift assay (CETSA) using PANC-1 pancreatic cancer cells when used at a concentration of 10 µM and enhances TRIM25-dependent ubiquitination of glutathione peroxidase 4 (GPX4) in a cell-free...
| Schlagworte: | 2-(chloromethyl)-6-(4-chlorophenyl)-thieno[3,2-d]pyrimidin-4(3H)-one |
| Anwendung: | Ferroptosis inducer, GPX4 degradation inducer |
| CAS | 851398-76-0 |
| MW: | 313.2 D |
ab 48,00 €
