Zu "84225-95-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Raclopride
Artikelnummer: TGM-T7635-100mg
Description: Raclopride is a selective antagonist of dopamine D2/D3 receptor. Target: Dopamine Receptor. Smiles: CCN1CCC[C@H]1CNC(=O)c1c(O)c(Cl)cc(Cl)c1OC. References: Ginovart, N. Imaging the dopamine system with in vivo [11C]raclopride displacement studies: Understanding the true mechanism. Mol. Imaging Biol. 7,...
| Anwendung: | Dopamine D2-receptor antagonist |
| CAS | 84225-95-6 |
| MW: | 347.24 D |
ab 45,00 €
Raclopride
Artikelnummer: Cay17422-10
Raclopride is a selective dopamine D2/D3 receptor antagonist with Ki values of 1.8, 3.5, 2,400, and 18,000 nM for D2, D3, D4, and D1 receptors, respectively. It passes the blood brain barrier and can be used in in vivo binding and autoradiography studies of the dopamine system under normal and pathological...
| Schlagworte: | (S)-(-)-Raclopride, 3,5-dichloro-N-[[(2S)-1-ethyl-2-pyrrolidinyl]methyl]-2-hydroxy-6-methoxy-benzamide |
| Anwendung: | Dopamine D2-receptor antagonist |
| CAS | 84225-95-6 |
| MW: | 347.2 D |
ab 67,00 €
