Zu "81065-76-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
EUK-134
Artikelnummer: TGM-T6495-100mg
Description: EUK-134, a synthetic superoxide dismutase (SOD)/catalase mimetic, exhibits potent antioxidant activities and inhibits the formation of beta-amyloid and related amyloid fibrils. Target: Beta Amyloid. Smiles: [Cl-][Mn+3]123[N](=CC=4C([O-]1)=C(OC)C=CC4)CC[N]2=CC=5C([O-]3)=C(OC)C=CC5. References: Baker K,...
| Schlagworte: | EUK 134 |
| CAS | 81065-76-1 |
| MW: | 416.74 D |
ab 31,00 €
EUK 134
Artikelnummer: Cay10006329-10
Synthetic manganese-porphyrin complexes have been documented to act as scavengers for oxidative species such as peroxynitrite, superoxide, and hydrogen peroxide. EUK 134 is a salen-manganese complex that has been modified to increase its catalase activity while retaining SOD activity. EUK 134 is a salen-manganese...
| Schlagworte: | chloro[[2,2'-[1,2-ethanediylbis[(nitrilo-kappaN)methylidyne]]bis[6-methoxyphenolato-kappaO]]]-manganese |
| Anwendung: | Antioxidant |
| CAS | 81065-76-1 |
| MW: | 416.7 D |
ab 53,00 €
