Zu "81-23-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Dehydrocholic acid
Artikelnummer: TGM-T0408-1g
Description: Dehydrocholic acid (Dehystolin) is a synthetic bile acid, produced by the oxidation of cholic acid. Target: Others. Smiles: CC(CCC(O)=O)C1CCC2C3C(CC(=O)C12C)C1(C)CCC(=O)CC1CC3=O. References: Yousef IM, et al. Digestion. 1990, 45(1):40-51.
| Schlagworte: | Felacrinos, Dehystolin, Sanocholen, Decholin |
| CAS | 81-23-2 |
| MW: | 402.52 D |
ab 31,00 €
Dehydrocholic Acid
Artikelnummer: Cay29176-1
Dehydrocholic acid is a synthetic bile acid and a derivative of cholic acid (Cay-20250). It increases bile flow by 2.7-fold and decreases biliary levels of phospholipids, cholesterol, and bilirubin in conscious dogs when administered at a dose of 50 mg/kg. Dehydrocholic acid (1 µmol/min/0.1 kg) increases bile flow...
| Schlagworte: | 3,7,12-Triketocholanic Acid, NSC 8796, Triketocholanoic Acid, (5beta)-3,7,12-trioxo-cholan-24-oic acid |
| Anwendung: | Synthetic bile acid |
| CAS | 81-23-2 |
| MW: | 402.5 D |
ab 44,00 €
