Zu "802539-81-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Milciclib
Artikelnummer: TGM-T6081-100mg
Description: Milciclib (PHA-848125) (PHA-848125) is a potent, ATP-competitive CDK inhibitor for CDK2 with IC50 of 45 nM. It is >3-fold more selective for CDK2 than CDK1, 2, 4, 5, and 7. Phase 2. Target: CDK, Autophagy, Trk receptor. Smiles: CNC(=O)c1nn(C)c-2c1C(C)(C)Cc1cnc(Nc3ccc(cc3)N3CCN(C)CC3)nc-21. References:...
| Schlagworte: | PHA-848125 |
| Anwendung: | Cdk inhibitor |
| CAS | 802539-81-7 |
| MW: | 460.57 D |
ab 83,00 €
PHA-848125
Artikelnummer: Cay21474-5
PHA-848125 is an ATP-competitive inhibitor of cyclin-dependent kinases (Cdks) that potently inhibits Cdk2/cyclin A (IC50 = 45 nM). It is at least 3-fold less potent at Cdks 1, 3, 4, 5, and 7. PHA-848125 is orally available and displays efficacy in suppressing the growth of cancer cells or tumor xenografts in...
| Schlagworte: | Milciclib,... |
| Anwendung: | Cdk inhibitor |
| CAS | 802539-81-7 |
| MW: | 460.6 D |
ab 85,00 €
