Zu "80-35-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Sulfamethoxypyridazine
Artikelnummer: TGM-T0844-100mg
Description: Sulfamethoxypyridazine (CL 13494) is a sulfanilamide antibacterial agent. Target: Antibacterial, PD-1/PD-L1, Antibiotic. Smiles: COc1ccc(NS(=O)(=O)c2ccc(N)cc2)nn1. References: Bartlett MS, et al. Antimicrob Agents Chemother, 1998, 42(4), 934-935.
| Schlagworte: | CL 13494 |
| CAS | 80-35-3 |
| MW: | 280.3 D |
ab 33,00 €
Sulfamethoxypyridazine
Artikelnummer: Cay21875-5
Sulfamethoxypyridazine is a sulfonamide antibiotic that inhibits the growth of Gram-negative bacteria and other microorganisms. It inhibits recombinant P. carinii dihydropteroate synthase (DHPS, IC50 = 17 nM) and folate biosynthesis in P. carinii by 75% when used at a concentration of 50 nM. Sulfamethoxypyridazine...
| Schlagworte: | 4-amino-N-(6-methoxy-3-pyridazinyl)-benzenesulfonamide |
| Anwendung: | Antibacterial sulfonamide antibiotic, Folic acid biosynthesis inhibitor |
| CAS | 80-35-3 |
| MW: | 280.3 D |
ab 43,00 €
