Zu "79236-56-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-Methylprotoporphyrin IX
Artikelnummer: TGM-T41281-1mg
Description: N-Methylprotoporphyrin IX, a potent inhibitor of the ferrochelatase enzyme[1]. Target: Others. Smiles: C(CC(O)=O)C=1C2=CC3=C(CCC(O)=O)C(C)=C(N3)C=C4C(C=C)=C(C)C(=N4)C=C5N(C)C(=CC(=N2)C1C)C(C)=C5C=C
| Anwendung: | Potent protoporphyrin IX ferrochelatase inhibitor |
| CAS | 79236-56-9 |
| MW: | 576.68 D |
ab 108,00 €
N-methyl Protoporphyrin IX
Artikelnummer: Cay20846-5
N-methyl Protoporphyrin IX is a transition state analog that potently inhibits protoporphyrin IX ferrochelatase (Ki = 10 nM), blocking the terminal step of the heme biosynthetic pathway. It is used to study the effect of heme synthesis blockade in cell systems.Formal Name:...
| Schlagworte: | N-methyl PPIX, NMPP, 7,12-diethenyl-3,8,13,17,23-pentamethyl-21H,23H-porphine-2,18-dipropanoic acid |
| Anwendung: | Potent protoporphyrin IX ferrochelatase inhibitor |
| CAS | 79236-56-9 |
| MW: | 576.7 D |
ab 60,00 €
